// Copyright 2012-2023 The NATS Authors // Licensed under the Apache License, Version 2.0 (the "License"); // you may not use this file except in compliance with the License. // You may obtain a copy of the License at // // http://www.apache.org/licenses/LICENSE-2.0 // // Unless required by applicable law or agreed to in writing, software // distributed under the License is distributed on an "AS IS" BASIS, // WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. // See the License for the specific language governing permissions and // limitations under the License. // A Go client for the NATS messaging system (https://nats.io). package nats import ( "bufio" "bytes" "crypto/tls" "crypto/x509" "encoding/base64" "encoding/json" "errors" "fmt" "io" "math/rand" "net" "net/http" "net/textproto" "net/url" "os" "path/filepath" "regexp" "runtime" "strconv" "strings" "sync" "sync/atomic" "time" "github.com/nats-io/nkeys" "github.com/nats-io/nuid" "github.com/nats-io/nats.go/util" ) // Default Constants const ( Version = "1.28.0" DefaultURL = "nats://127.0.0.1:4222" DefaultPort = 4222 DefaultMaxReconnect = 60 DefaultReconnectWait = 2 * time.Second DefaultReconnectJitter = 100 * time.Millisecond DefaultReconnectJitterTLS = time.Second DefaultTimeout = 2 * time.Second DefaultPingInterval = 2 * time.Minute DefaultMaxPingOut = 2 DefaultMaxChanLen = 64 * 1024 // 64k DefaultReconnectBufSize = 8 * 1024 * 1024 // 8MB RequestChanLen = 8 DefaultDrainTimeout = 30 * time.Second LangString = "go" ) const ( // STALE_CONNECTION is for detection and proper handling of stale connections. STALE_CONNECTION = "stale connection" // PERMISSIONS_ERR is for when nats server subject authorization has failed. PERMISSIONS_ERR = "permissions violation" // AUTHORIZATION_ERR is for when nats server user authorization has failed. AUTHORIZATION_ERR = "authorization violation" // AUTHENTICATION_EXPIRED_ERR is for when nats server user authorization has expired. AUTHENTICATION_EXPIRED_ERR = "user authentication expired" // AUTHENTICATION_REVOKED_ERR is for when user authorization has been revoked. AUTHENTICATION_REVOKED_ERR = "user authentication revoked" // ACCOUNT_AUTHENTICATION_EXPIRED_ERR is for when nats server account authorization has expired. ACCOUNT_AUTHENTICATION_EXPIRED_ERR = "account authentication expired" // MAX_CONNECTIONS_ERR is for when nats server denies the connection due to server max_connections limit MAX_CONNECTIONS_ERR = "maximum connections exceeded" ) // Errors var ( ErrConnectionClosed = errors.New("nats: connection closed") ErrConnectionDraining = errors.New("nats: connection draining") ErrDrainTimeout = errors.New("nats: draining connection timed out") ErrConnectionReconnecting = errors.New("nats: connection reconnecting") ErrSecureConnRequired = errors.New("nats: secure connection required") ErrSecureConnWanted = errors.New("nats: secure connection not available") ErrBadSubscription = errors.New("nats: invalid subscription") ErrTypeSubscription = errors.New("nats: invalid subscription type") ErrBadSubject = errors.New("nats: invalid subject") ErrBadQueueName = errors.New("nats: invalid queue name") ErrSlowConsumer = errors.New("nats: slow consumer, messages dropped") ErrTimeout = errors.New("nats: timeout") ErrBadTimeout = errors.New("nats: timeout invalid") ErrAuthorization = errors.New("nats: authorization violation") ErrAuthExpired = errors.New("nats: authentication expired") ErrAuthRevoked = errors.New("nats: authentication revoked") ErrAccountAuthExpired = errors.New("nats: account authentication expired") ErrNoServers = errors.New("nats: no servers available for connection") ErrJsonParse = errors.New("nats: connect message, json parse error") ErrChanArg = errors.New("nats: argument needs to be a channel type") ErrMaxPayload = errors.New("nats: maximum payload exceeded") ErrMaxMessages = errors.New("nats: maximum messages delivered") ErrSyncSubRequired = errors.New("nats: illegal call on an async subscription") ErrMultipleTLSConfigs = errors.New("nats: multiple tls.Configs not allowed") ErrNoInfoReceived = errors.New("nats: protocol exception, INFO not received") ErrReconnectBufExceeded = errors.New("nats: outbound buffer limit exceeded") ErrInvalidConnection = errors.New("nats: invalid connection") ErrInvalidMsg = errors.New("nats: invalid message or message nil") ErrInvalidArg = errors.New("nats: invalid argument") ErrInvalidContext = errors.New("nats: invalid context") ErrNoDeadlineContext = errors.New("nats: context requires a deadline") ErrNoEchoNotSupported = errors.New("nats: no echo option not supported by this server") ErrClientIDNotSupported = errors.New("nats: client ID not supported by this server") ErrUserButNoSigCB = errors.New("nats: user callback defined without a signature handler") ErrNkeyButNoSigCB = errors.New("nats: nkey defined without a signature handler") ErrNoUserCB = errors.New("nats: user callback not defined") ErrNkeyAndUser = errors.New("nats: user callback and nkey defined") ErrNkeysNotSupported = errors.New("nats: nkeys not supported by the server") ErrStaleConnection = errors.New("nats: " + STALE_CONNECTION) ErrTokenAlreadySet = errors.New("nats: token and token handler both set") ErrMsgNotBound = errors.New("nats: message is not bound to subscription/connection") ErrMsgNoReply = errors.New("nats: message does not have a reply") ErrClientIPNotSupported = errors.New("nats: client IP not supported by this server") ErrDisconnected = errors.New("nats: server is disconnected") ErrHeadersNotSupported = errors.New("nats: headers not supported by this server") ErrBadHeaderMsg = errors.New("nats: message could not decode headers") ErrNoResponders = errors.New("nats: no responders available for request") ErrMaxConnectionsExceeded = errors.New("nats: server maximum connections exceeded") ErrConnectionNotTLS = errors.New("nats: connection is not tls") ) // GetDefaultOptions returns default configuration options for the client. func GetDefaultOptions() Options { return Options{ AllowReconnect: true, MaxReconnect: DefaultMaxReconnect, ReconnectWait: DefaultReconnectWait, ReconnectJitter: DefaultReconnectJitter, ReconnectJitterTLS: DefaultReconnectJitterTLS, Timeout: DefaultTimeout, PingInterval: DefaultPingInterval, MaxPingsOut: DefaultMaxPingOut, SubChanLen: DefaultMaxChanLen, ReconnectBufSize: DefaultReconnectBufSize, DrainTimeout: DefaultDrainTimeout, } } // DEPRECATED: Use GetDefaultOptions() instead. // DefaultOptions is not safe for use by multiple clients. // For details see #308. var DefaultOptions = GetDefaultOptions() // Status represents the state of the connection. type Status int const ( DISCONNECTED = Status(iota) CONNECTED CLOSED RECONNECTING CONNECTING DRAINING_SUBS DRAINING_PUBS ) func (s Status) String() string { switch s { case DISCONNECTED: return "DISCONNECTED" case CONNECTED: return "CONNECTED" case CLOSED: return "CLOSED" case RECONNECTING: return "RECONNECTING" case CONNECTING: return "CONNECTING" case DRAINING_SUBS: return "DRAINING_SUBS" case DRAINING_PUBS: return "DRAINING_PUBS" } return "unknown status" } // ConnHandler is used for asynchronous events such as // disconnected and closed connections. type ConnHandler func(*Conn) // ConnErrHandler is used to process asynchronous events like // disconnected connection with the error (if any). type ConnErrHandler func(*Conn, error) // ErrHandler is used to process asynchronous errors encountered // while processing inbound messages. type ErrHandler func(*Conn, *Subscription, error) // UserJWTHandler is used to fetch and return the account signed // JWT for this user. type UserJWTHandler func() (string, error) // TLSCertHandler is used to fetch and return tls certificate. type TLSCertHandler func() (tls.Certificate, error) // RootCAsHandler is used to fetch and return a set of root certificate // authorities that clients use when verifying server certificates. type RootCAsHandler func() (*x509.CertPool, error) // SignatureHandler is used to sign a nonce from the server while // authenticating with nkeys. The user should sign the nonce and // return the raw signature. The client will base64 encode this to // send to the server. type SignatureHandler func([]byte) ([]byte, error) // AuthTokenHandler is used to generate a new token. type AuthTokenHandler func() string // ReconnectDelayHandler is used to get from the user the desired // delay the library should pause before attempting to reconnect // again. Note that this is invoked after the library tried the // whole list of URLs and failed to reconnect. type ReconnectDelayHandler func(attempts int) time.Duration // asyncCB is used to preserve order for async callbacks. type asyncCB struct { f func() next *asyncCB } type asyncCallbacksHandler struct { mu sync.Mutex cond *sync.Cond head *asyncCB tail *asyncCB } // Option is a function on the options for a connection. type Option func(*Options) error // CustomDialer can be used to specify any dialer, not necessarily a // *net.Dialer. A CustomDialer may also implement `SkipTLSHandshake() bool` // in order to skip the TLS handshake in case not required. type CustomDialer interface { Dial(network, address string) (net.Conn, error) } type InProcessConnProvider interface { InProcessConn() (net.Conn, error) } // Options can be used to create a customized connection. type Options struct { // Url represents a single NATS server url to which the client // will be connecting. If the Servers option is also set, it // then becomes the first server in the Servers array. Url string // InProcessServer represents a NATS server running within the // same process. If this is set then we will attempt to connect // to the server directly rather than using external TCP conns. InProcessServer InProcessConnProvider // Servers is a configured set of servers which this client // will use when attempting to connect. Servers []string // NoRandomize configures whether we will randomize the // server pool. NoRandomize bool // NoEcho configures whether the server will echo back messages // that are sent on this connection if we also have matching subscriptions. // Note this is supported on servers >= version 1.2. Proto 1 or greater. NoEcho bool // Name is an optional name label which will be sent to the server // on CONNECT to identify the client. Name string // Verbose signals the server to send an OK ack for commands // successfully processed by the server. Verbose bool // Pedantic signals the server whether it should be doing further // validation of subjects. Pedantic bool // Secure enables TLS secure connections that skip server // verification by default. NOT RECOMMENDED. Secure bool // TLSConfig is a custom TLS configuration to use for secure // transports. TLSConfig *tls.Config // TLSCertCB is used to fetch and return custom tls certificate. TLSCertCB TLSCertHandler // RootCAsCB is used to fetch and return a set of root certificate // authorities that clients use when verifying server certificates. RootCAsCB RootCAsHandler // AllowReconnect enables reconnection logic to be used when we // encounter a disconnect from the current server. AllowReconnect bool // MaxReconnect sets the number of reconnect attempts that will be // tried before giving up. If negative, then it will never give up // trying to reconnect. // Defaults to 60. MaxReconnect int // ReconnectWait sets the time to backoff after attempting a reconnect // to a server that we were already connected to previously. // Defaults to 2s. ReconnectWait time.Duration // CustomReconnectDelayCB is invoked after the library tried every // URL in the server list and failed to reconnect. It passes to the // user the current number of attempts. This function returns the // amount of time the library will sleep before attempting to reconnect // again. It is strongly recommended that this value contains some // jitter to prevent all connections to attempt reconnecting at the same time. CustomReconnectDelayCB ReconnectDelayHandler // ReconnectJitter sets the upper bound for a random delay added to // ReconnectWait during a reconnect when no TLS is used. // Defaults to 100ms. ReconnectJitter time.Duration // ReconnectJitterTLS sets the upper bound for a random delay added to // ReconnectWait during a reconnect when TLS is used. // Defaults to 1s. ReconnectJitterTLS time.Duration // Timeout sets the timeout for a Dial operation on a connection. // Defaults to 2s. Timeout time.Duration // DrainTimeout sets the timeout for a Drain Operation to complete. // Defaults to 30s. DrainTimeout time.Duration // FlusherTimeout is the maximum time to wait for write operations // to the underlying connection to complete (including the flusher loop). FlusherTimeout time.Duration // PingInterval is the period at which the client will be sending ping // commands to the server, disabled if 0 or negative. // Defaults to 2m. PingInterval time.Duration // MaxPingsOut is the maximum number of pending ping commands that can // be awaiting a response before raising an ErrStaleConnection error. // Defaults to 2. MaxPingsOut int // ClosedCB sets the closed handler that is called when a client will // no longer be connected. ClosedCB ConnHandler // DisconnectedCB sets the disconnected handler that is called // whenever the connection is disconnected. // Will not be called if DisconnectedErrCB is set // DEPRECATED. Use DisconnectedErrCB which passes error that caused // the disconnect event. DisconnectedCB ConnHandler // DisconnectedErrCB sets the disconnected error handler that is called // whenever the connection is disconnected. // Disconnected error could be nil, for instance when user explicitly closes the connection. // DisconnectedCB will not be called if DisconnectedErrCB is set DisconnectedErrCB ConnErrHandler // ConnectedCB sets the connected handler called when the initial connection // is established. It is not invoked on successful reconnects - for reconnections, // use ReconnectedCB. ConnectedCB can be used in conjunction with RetryOnFailedConnect // to detect whether the initial connect was successful. ConnectedCB ConnHandler // ReconnectedCB sets the reconnected handler called whenever // the connection is successfully reconnected. ReconnectedCB ConnHandler // DiscoveredServersCB sets the callback that is invoked whenever a new // server has joined the cluster. DiscoveredServersCB ConnHandler // AsyncErrorCB sets the async error handler (e.g. slow consumer errors) AsyncErrorCB ErrHandler // ReconnectBufSize is the size of the backing bufio during reconnect. // Once this has been exhausted publish operations will return an error. // Defaults to 8388608 bytes (8MB). ReconnectBufSize int // SubChanLen is the size of the buffered channel used between the socket // Go routine and the message delivery for SyncSubscriptions. // NOTE: This does not affect AsyncSubscriptions which are // dictated by PendingLimits() // Defaults to 65536. SubChanLen int // UserJWT sets the callback handler that will fetch a user's JWT. UserJWT UserJWTHandler // Nkey sets the public nkey that will be used to authenticate // when connecting to the server. UserJWT and Nkey are mutually exclusive // and if defined, UserJWT will take precedence. Nkey string // SignatureCB designates the function used to sign the nonce // presented from the server. SignatureCB SignatureHandler // User sets the username to be used when connecting to the server. User string // Password sets the password to be used when connecting to a server. Password string // Token sets the token to be used when connecting to a server. Token string // TokenHandler designates the function used to generate the token to be used when connecting to a server. TokenHandler AuthTokenHandler // Dialer allows a custom net.Dialer when forming connections. // DEPRECATED: should use CustomDialer instead. Dialer *net.Dialer // CustomDialer allows to specify a custom dialer (not necessarily // a *net.Dialer). CustomDialer CustomDialer // UseOldRequestStyle forces the old method of Requests that utilize // a new Inbox and a new Subscription for each request. UseOldRequestStyle bool // NoCallbacksAfterClientClose allows preventing the invocation of // callbacks after Close() is called. Client won't receive notifications // when Close is invoked by user code. Default is to invoke the callbacks. NoCallbacksAfterClientClose bool // LameDuckModeHandler sets the callback to invoke when the server notifies // the connection that it entered lame duck mode, that is, going to // gradually disconnect all its connections before shutting down. This is // often used in deployments when upgrading NATS Servers. LameDuckModeHandler ConnHandler // RetryOnFailedConnect sets the connection in reconnecting state right // away if it can't connect to a server in the initial set. The // MaxReconnect and ReconnectWait options are used for this process, // similarly to when an established connection is disconnected. // If a ReconnectHandler is set, it will be invoked on the first // successful reconnect attempt (if the initial connect fails), // and if a ClosedHandler is set, it will be invoked if // it fails to connect (after exhausting the MaxReconnect attempts). RetryOnFailedConnect bool // For websocket connections, indicates to the server that the connection // supports compression. If the server does too, then data will be compressed. Compression bool // For websocket connections, adds a path to connections url. // This is useful when connecting to NATS behind a proxy. ProxyPath string // InboxPrefix allows the default _INBOX prefix to be customized InboxPrefix string // IgnoreAuthErrorAbort - if set to true, client opts out of the default connect behavior of aborting // subsequent reconnect attempts if server returns the same auth error twice (regardless of reconnect policy). IgnoreAuthErrorAbort bool // SkipHostLookup skips the DNS lookup for the server hostname. SkipHostLookup bool } const ( // Scratch storage for assembling protocol headers scratchSize = 512 // The size of the bufio reader/writer on top of the socket. defaultBufSize = 32768 // The buffered size of the flush "kick" channel flushChanSize = 1 // Default server pool size srvPoolSize = 4 // NUID size nuidSize = 22 // Default ports used if none is specified in given URL(s) defaultWSPortString = "80" defaultWSSPortString = "443" defaultPortString = "4222" ) // A Conn represents a bare connection to a nats-server. // It can send and receive []byte payloads. // The connection is safe to use in multiple Go routines concurrently. type Conn struct { // Keep all members for which we use atomic at the beginning of the // struct and make sure they are all 64bits (or use padding if necessary). // atomic.* functions crash on 32bit machines if operand is not aligned // at 64bit. See https://github.com/golang/go/issues/599 Statistics mu sync.RWMutex // Opts holds the configuration of the Conn. // Modifying the configuration of a running Conn is a race. Opts Options wg sync.WaitGroup srvPool []*srv current *srv urls map[string]struct{} // Keep track of all known URLs (used by processInfo) conn net.Conn bw *natsWriter br *natsReader fch chan struct{} info serverInfo ssid int64 subsMu sync.RWMutex subs map[int64]*Subscription ach *asyncCallbacksHandler pongs []chan struct{} scratch [scratchSize]byte status Status statListeners map[Status][]chan Status initc bool // true if the connection is performing the initial connect err error ps *parseState ptmr *time.Timer pout int ar bool // abort reconnect rqch chan struct{} ws bool // true if a websocket connection // New style response handler respSub string // The wildcard subject respSubPrefix string // the wildcard prefix including trailing . respSubLen int // the length of the wildcard prefix excluding trailing . respScanf string // The scanf template to extract mux token respMux *Subscription // A single response subscription respMap map[string]chan *Msg // Request map for the response msg channels respRand *rand.Rand // Used for generating suffix // Msg filters for testing. // Protected by subsMu filters map[string]msgFilter } type natsReader struct { r io.Reader buf []byte off int n int } type natsWriter struct { w io.Writer bufs []byte limit int pending *bytes.Buffer plimit int } // Subscription represents interest in a given subject. type Subscription struct { mu sync.Mutex sid int64 // Subject that represents this subscription. This can be different // than the received subject inside a Msg if this is a wildcard. Subject string // Optional queue group name. If present, all subscriptions with the // same name will form a distributed queue, and each message will // only be processed by one member of the group. Queue string // For holding information about a JetStream consumer. jsi *jsSub delivered uint64 max uint64 conn *Conn mcb MsgHandler mch chan *Msg closed bool sc bool connClosed bool // Type of Subscription typ SubscriptionType // Async linked list pHead *Msg pTail *Msg pCond *sync.Cond pDone func() // Pending stats, async subscriptions, high-speed etc. pMsgs int pBytes int pMsgsMax int pBytesMax int pMsgsLimit int pBytesLimit int dropped int } // Msg represents a message delivered by NATS. This structure is used // by Subscribers and PublishMsg(). // // # Types of Acknowledgements // // In case using JetStream, there are multiple ways to ack a Msg: // // // Acknowledgement that a message has been processed. // msg.Ack() // // // Negatively acknowledges a message. // msg.Nak() // // // Terminate a message so that it is not redelivered further. // msg.Term() // // // Signal the server that the message is being worked on and reset redelivery timer. // msg.InProgress() type Msg struct { Subject string Reply string Header Header Data []byte Sub *Subscription // Internal next *Msg wsz int barrier *barrierInfo ackd uint32 } // Compares two msgs, ignores sub but checks all other public fields. func (m *Msg) Equal(msg *Msg) bool { if m == msg { return true } if m == nil || msg == nil { return false } if m.Subject != msg.Subject || m.Reply != msg.Reply { return false } if !bytes.Equal(m.Data, msg.Data) { return false } if len(m.Header) != len(msg.Header) { return false } for k, v := range m.Header { val, ok := msg.Header[k] if !ok || len(v) != len(val) { return false } for i, hdr := range v { if hdr != val[i] { return false } } } return true } // Size returns a message size in bytes. func (m *Msg) Size() int { if m.wsz != 0 { return m.wsz } hdr, _ := m.headerBytes() return len(m.Subject) + len(m.Reply) + len(hdr) + len(m.Data) } func (m *Msg) headerBytes() ([]byte, error) { var hdr []byte if len(m.Header) == 0 { return hdr, nil } var b bytes.Buffer _, err := b.WriteString(hdrLine) if err != nil { return nil, ErrBadHeaderMsg } err = http.Header(m.Header).Write(&b) if err != nil { return nil, ErrBadHeaderMsg } _, err = b.WriteString(crlf) if err != nil { return nil, ErrBadHeaderMsg } return b.Bytes(), nil } type barrierInfo struct { refs int64 f func() } // Tracks various stats received and sent on this connection, // including counts for messages and bytes. type Statistics struct { InMsgs uint64 OutMsgs uint64 InBytes uint64 OutBytes uint64 Reconnects uint64 } // Tracks individual backend servers. type srv struct { url *url.URL didConnect bool reconnects int lastErr error isImplicit bool tlsName string } // The INFO block received from the server. type serverInfo struct { ID string `json:"server_id"` Name string `json:"server_name"` Proto int `json:"proto"` Version string `json:"version"` Host string `json:"host"` Port int `json:"port"` Headers bool `json:"headers"` AuthRequired bool `json:"auth_required,omitempty"` TLSRequired bool `json:"tls_required,omitempty"` TLSAvailable bool `json:"tls_available,omitempty"` MaxPayload int64 `json:"max_payload"` CID uint64 `json:"client_id,omitempty"` ClientIP string `json:"client_ip,omitempty"` Nonce string `json:"nonce,omitempty"` Cluster string `json:"cluster,omitempty"` ConnectURLs []string `json:"connect_urls,omitempty"` LameDuckMode bool `json:"ldm,omitempty"` } const ( // clientProtoZero is the original client protocol from 2009. // http://nats.io/documentation/internals/nats-protocol/ /* clientProtoZero */ _ = iota // clientProtoInfo signals a client can receive more then the original INFO block. // This can be used to update clients on other cluster members, etc. clientProtoInfo ) type connectInfo struct { Verbose bool `json:"verbose"` Pedantic bool `json:"pedantic"` UserJWT string `json:"jwt,omitempty"` Nkey string `json:"nkey,omitempty"` Signature string `json:"sig,omitempty"` User string `json:"user,omitempty"` Pass string `json:"pass,omitempty"` Token string `json:"auth_token,omitempty"` TLS bool `json:"tls_required"` Name string `json:"name"` Lang string `json:"lang"` Version string `json:"version"` Protocol int `json:"protocol"` Echo bool `json:"echo"` Headers bool `json:"headers"` NoResponders bool `json:"no_responders"` } // MsgHandler is a callback function that processes messages delivered to // asynchronous subscribers. type MsgHandler func(msg *Msg) // Connect will attempt to connect to the NATS system. // The url can contain username/password semantics. e.g. nats://derek:pass@localhost:4222 // Comma separated arrays are also supported, e.g. urlA, urlB. // Options start with the defaults but can be overridden. // To connect to a NATS Server's websocket port, use the `ws` or `wss` scheme, such as // `ws://localhost:8080`. Note that websocket schemes cannot be mixed with others (nats/tls). func Connect(url string, options ...Option) (*Conn, error) { opts := GetDefaultOptions() opts.Servers = processUrlString(url) for _, opt := range options { if opt != nil { if err := opt(&opts); err != nil { return nil, err } } } return opts.Connect() } // Options that can be passed to Connect. // Name is an Option to set the client name. func Name(name string) Option { return func(o *Options) error { o.Name = name return nil } } // InProcessServer is an Option that will try to establish a direction to a NATS server // running within the process instead of dialing via TCP. func InProcessServer(server InProcessConnProvider) Option { return func(o *Options) error { o.InProcessServer = server return nil } } // Secure is an Option to enable TLS secure connections that skip server verification by default. // Pass a TLS Configuration for proper TLS. // NOTE: This should NOT be used in a production setting. func Secure(tls ...*tls.Config) Option { return func(o *Options) error { o.Secure = true // Use of variadic just simplifies testing scenarios. We only take the first one. if len(tls) > 1 { return ErrMultipleTLSConfigs } if len(tls) == 1 { o.TLSConfig = tls[0] } return nil } } // RootCAs is a helper option to provide the RootCAs pool from a list of filenames. // If Secure is not already set this will set it as well. func RootCAs(file ...string) Option { return func(o *Options) error { rootCAsCB := func() (*x509.CertPool, error) { pool := x509.NewCertPool() for _, f := range file { rootPEM, err := os.ReadFile(f) if err != nil || rootPEM == nil { return nil, fmt.Errorf("nats: error loading or parsing rootCA file: %w", err) } ok := pool.AppendCertsFromPEM(rootPEM) if !ok { return nil, fmt.Errorf("nats: failed to parse root certificate from %q", f) } } return pool, nil } if o.TLSConfig == nil { o.TLSConfig = &tls.Config{MinVersion: tls.VersionTLS12} } if _, err := rootCAsCB(); err != nil { return err } o.RootCAsCB = rootCAsCB o.Secure = true return nil } } // ClientCert is a helper option to provide the client certificate from a file. // If Secure is not already set this will set it as well. func ClientCert(certFile, keyFile string) Option { return func(o *Options) error { tlsCertCB := func() (tls.Certificate, error) { cert, err := tls.LoadX509KeyPair(certFile, keyFile) if err != nil { return tls.Certificate{}, fmt.Errorf("nats: error loading client certificate: %w", err) } cert.Leaf, err = x509.ParseCertificate(cert.Certificate[0]) if err != nil { return tls.Certificate{}, fmt.Errorf("nats: error parsing client certificate: %w", err) } return cert, nil } if o.TLSConfig == nil { o.TLSConfig = &tls.Config{MinVersion: tls.VersionTLS12} } if _, err := tlsCertCB(); err != nil { return err } o.TLSCertCB = tlsCertCB o.Secure = true return nil } } // NoReconnect is an Option to turn off reconnect behavior. func NoReconnect() Option { return func(o *Options) error { o.AllowReconnect = false return nil } } // DontRandomize is an Option to turn off randomizing the server pool. func DontRandomize() Option { return func(o *Options) error { o.NoRandomize = true return nil } } // NoEcho is an Option to turn off messages echoing back from a server. // Note this is supported on servers >= version 1.2. Proto 1 or greater. func NoEcho() Option { return func(o *Options) error { o.NoEcho = true return nil } } // ReconnectWait is an Option to set the wait time between reconnect attempts. // Defaults to 2s. func ReconnectWait(t time.Duration) Option { return func(o *Options) error { o.ReconnectWait = t return nil } } // MaxReconnects is an Option to set the maximum number of reconnect attempts. // Defaults to 60. func MaxReconnects(max int) Option { return func(o *Options) error { o.MaxReconnect = max return nil } } // ReconnectJitter is an Option to set the upper bound of a random delay added ReconnectWait. // Defaults to 100ms and 1s, respectively. func ReconnectJitter(jitter, jitterForTLS time.Duration) Option { return func(o *Options) error { o.ReconnectJitter = jitter o.ReconnectJitterTLS = jitterForTLS return nil } } // CustomReconnectDelay is an Option to set the CustomReconnectDelayCB option. // See CustomReconnectDelayCB Option for more details. func CustomReconnectDelay(cb ReconnectDelayHandler) Option { return func(o *Options) error { o.CustomReconnectDelayCB = cb return nil } } // PingInterval is an Option to set the period for client ping commands. // Defaults to 2m. func PingInterval(t time.Duration) Option { return func(o *Options) error { o.PingInterval = t return nil } } // MaxPingsOutstanding is an Option to set the maximum number of ping requests // that can go unanswered by the server before closing the connection. // Defaults to 2. func MaxPingsOutstanding(max int) Option { return func(o *Options) error { o.MaxPingsOut = max return nil } } // ReconnectBufSize sets the buffer size of messages kept while busy reconnecting. // Defaults to 8388608 bytes (8MB). It can be disabled by setting it to -1. func ReconnectBufSize(size int) Option { return func(o *Options) error { o.ReconnectBufSize = size return nil } } // Timeout is an Option to set the timeout for Dial on a connection. // Defaults to 2s. func Timeout(t time.Duration) Option { return func(o *Options) error { o.Timeout = t return nil } } // FlusherTimeout is an Option to set the write (and flush) timeout on a connection. func FlusherTimeout(t time.Duration) Option { return func(o *Options) error { o.FlusherTimeout = t return nil } } // DrainTimeout is an Option to set the timeout for draining a connection. // Defaults to 30s. func DrainTimeout(t time.Duration) Option { return func(o *Options) error { o.DrainTimeout = t return nil } } // DisconnectErrHandler is an Option to set the disconnected error handler. func DisconnectErrHandler(cb ConnErrHandler) Option { return func(o *Options) error { o.DisconnectedErrCB = cb return nil } } // DisconnectHandler is an Option to set the disconnected handler. // DEPRECATED: Use DisconnectErrHandler. func DisconnectHandler(cb ConnHandler) Option { return func(o *Options) error { o.DisconnectedCB = cb return nil } } // ConnectHandler is an Option to set the connected handler. func ConnectHandler(cb ConnHandler) Option { return func(o *Options) error { o.ConnectedCB = cb return nil } } // ReconnectHandler is an Option to set the reconnected handler. func ReconnectHandler(cb ConnHandler) Option { return func(o *Options) error { o.ReconnectedCB = cb return nil } } // ClosedHandler is an Option to set the closed handler. func ClosedHandler(cb ConnHandler) Option { return func(o *Options) error { o.ClosedCB = cb return nil } } // DiscoveredServersHandler is an Option to set the new servers handler. func DiscoveredServersHandler(cb ConnHandler) Option { return func(o *Options) error { o.DiscoveredServersCB = cb return nil } } // ErrorHandler is an Option to set the async error handler. func ErrorHandler(cb ErrHandler) Option { return func(o *Options) error { o.AsyncErrorCB = cb return nil } } // UserInfo is an Option to set the username and password to // use when not included directly in the URLs. func UserInfo(user, password string) Option { return func(o *Options) error { o.User = user o.Password = password return nil } } // Token is an Option to set the token to use // when a token is not included directly in the URLs // and when a token handler is not provided. func Token(token string) Option { return func(o *Options) error { if o.TokenHandler != nil { return ErrTokenAlreadySet } o.Token = token return nil } } // TokenHandler is an Option to set the token handler to use // when a token is not included directly in the URLs // and when a token is not set. func TokenHandler(cb AuthTokenHandler) Option { return func(o *Options) error { if o.Token != "" { return ErrTokenAlreadySet } o.TokenHandler = cb return nil } } // UserCredentials is a convenience function that takes a filename // for a user's JWT and a filename for the user's private Nkey seed. func UserCredentials(userOrChainedFile string, seedFiles ...string) Option { userCB := func() (string, error) { return userFromFile(userOrChainedFile) } var keyFile string if len(seedFiles) > 0 { keyFile = seedFiles[0] } else { keyFile = userOrChainedFile } sigCB := func(nonce []byte) ([]byte, error) { return sigHandler(nonce, keyFile) } return UserJWT(userCB, sigCB) } // UserJWTAndSeed is a convenience function that takes the JWT and seed // values as strings. func UserJWTAndSeed(jwt string, seed string) Option { userCB := func() (string, error) { return jwt, nil } sigCB := func(nonce []byte) ([]byte, error) { kp, err := nkeys.FromSeed([]byte(seed)) if err != nil { return nil, fmt.Errorf("unable to extract key pair from seed: %w", err) } // Wipe our key on exit. defer kp.Wipe() sig, _ := kp.Sign(nonce) return sig, nil } return UserJWT(userCB, sigCB) } // UserJWT will set the callbacks to retrieve the user's JWT and // the signature callback to sign the server nonce. This an the Nkey // option are mutually exclusive. func UserJWT(userCB UserJWTHandler, sigCB SignatureHandler) Option { return func(o *Options) error { if userCB == nil { return ErrNoUserCB } if sigCB == nil { return ErrUserButNoSigCB } // Smoke test the user callback to ensure it is setup properly // when processing options. if _, err := userCB(); err != nil { return err } o.UserJWT = userCB o.SignatureCB = sigCB return nil } } // Nkey will set the public Nkey and the signature callback to // sign the server nonce. func Nkey(pubKey string, sigCB SignatureHandler) Option { return func(o *Options) error { o.Nkey = pubKey o.SignatureCB = sigCB if pubKey != "" && sigCB == nil { return ErrNkeyButNoSigCB } return nil } } // SyncQueueLen will set the maximum queue len for the internal // channel used for SubscribeSync(). // Defaults to 65536. func SyncQueueLen(max int) Option { return func(o *Options) error { o.SubChanLen = max return nil } } // Dialer is an Option to set the dialer which will be used when // attempting to establish a connection. // DEPRECATED: Should use CustomDialer instead. func Dialer(dialer *net.Dialer) Option { return func(o *Options) error { o.Dialer = dialer return nil } } // SetCustomDialer is an Option to set a custom dialer which will be // used when attempting to establish a connection. If both Dialer // and CustomDialer are specified, CustomDialer takes precedence. func SetCustomDialer(dialer CustomDialer) Option { return func(o *Options) error { o.CustomDialer = dialer return nil } } // UseOldRequestStyle is an Option to force usage of the old Request style. func UseOldRequestStyle() Option { return func(o *Options) error { o.UseOldRequestStyle = true return nil } } // NoCallbacksAfterClientClose is an Option to disable callbacks when user code // calls Close(). If close is initiated by any other condition, callbacks // if any will be invoked. func NoCallbacksAfterClientClose() Option { return func(o *Options) error { o.NoCallbacksAfterClientClose = true return nil } } // LameDuckModeHandler sets the callback to invoke when the server notifies // the connection that it entered lame duck mode, that is, going to // gradually disconnect all its connections before shutting down. This is // often used in deployments when upgrading NATS Servers. func LameDuckModeHandler(cb ConnHandler) Option { return func(o *Options) error { o.LameDuckModeHandler = cb return nil } } // RetryOnFailedConnect sets the connection in reconnecting state right away // if it can't connect to a server in the initial set. // See RetryOnFailedConnect option for more details. func RetryOnFailedConnect(retry bool) Option { return func(o *Options) error { o.RetryOnFailedConnect = retry return nil } } // Compression is an Option to indicate if this connection supports // compression. Currently only supported for Websocket connections. func Compression(enabled bool) Option { return func(o *Options) error { o.Compression = enabled return nil } } // ProxyPath is an option for websocket connections that adds a path to connections url. // This is useful when connecting to NATS behind a proxy. func ProxyPath(path string) Option { return func(o *Options) error { o.ProxyPath = path return nil } } // CustomInboxPrefix configures the request + reply inbox prefix func CustomInboxPrefix(p string) Option { return func(o *Options) error { if p == "" || strings.Contains(p, ">") || strings.Contains(p, "*") || strings.HasSuffix(p, ".") { return fmt.Errorf("nats: invalid custom prefix") } o.InboxPrefix = p return nil } } // IgnoreAuthErrorAbort opts out of the default connect behavior of aborting // subsequent reconnect attempts if server returns the same auth error twice. func IgnoreAuthErrorAbort() Option { return func(o *Options) error { o.IgnoreAuthErrorAbort = true return nil } } // SkipHostLookup is an Option to skip the host lookup when connecting to a server. func SkipHostLookup() Option { return func(o *Options) error { o.SkipHostLookup = true return nil } } // Handler processing // SetDisconnectHandler will set the disconnect event handler. // DEPRECATED: Use SetDisconnectErrHandler func (nc *Conn) SetDisconnectHandler(dcb ConnHandler) { if nc == nil { return } nc.mu.Lock() defer nc.mu.Unlock() nc.Opts.DisconnectedCB = dcb } // SetDisconnectErrHandler will set the disconnect event handler. func (nc *Conn) SetDisconnectErrHandler(dcb ConnErrHandler) { if nc == nil { return } nc.mu.Lock() defer nc.mu.Unlock() nc.Opts.DisconnectedErrCB = dcb } // DisconnectErrHandler will return the disconnect event handler. func (nc *Conn) DisconnectErrHandler() ConnErrHandler { if nc == nil { return nil } nc.mu.Lock() defer nc.mu.Unlock() return nc.Opts.DisconnectedErrCB } // SetReconnectHandler will set the reconnect event handler. func (nc *Conn) SetReconnectHandler(rcb ConnHandler) { if nc == nil { return } nc.mu.Lock() defer nc.mu.Unlock() nc.Opts.ReconnectedCB = rcb } // ReconnectHandler will return the reconnect event handler. func (nc *Conn) ReconnectHandler() ConnHandler { if nc == nil { return nil } nc.mu.Lock() defer nc.mu.Unlock() return nc.Opts.ReconnectedCB } // SetDiscoveredServersHandler will set the discovered servers handler. func (nc *Conn) SetDiscoveredServersHandler(dscb ConnHandler) { if nc == nil { return } nc.mu.Lock() defer nc.mu.Unlock() nc.Opts.DiscoveredServersCB = dscb } // DiscoveredServersHandler will return the discovered servers handler. func (nc *Conn) DiscoveredServersHandler() ConnHandler { if nc == nil { return nil } nc.mu.Lock() defer nc.mu.Unlock() return nc.Opts.DiscoveredServersCB } // SetClosedHandler will set the closed event handler. func (nc *Conn) SetClosedHandler(cb ConnHandler) { if nc == nil { return } nc.mu.Lock() defer nc.mu.Unlock() nc.Opts.ClosedCB = cb } // ClosedHandler will return the closed event handler. func (nc *Conn) ClosedHandler() ConnHandler { if nc == nil { return nil } nc.mu.Lock() defer nc.mu.Unlock() return nc.Opts.ClosedCB } // SetErrorHandler will set the async error handler. func (nc *Conn) SetErrorHandler(cb ErrHandler) { if nc == nil { return } nc.mu.Lock() defer nc.mu.Unlock() nc.Opts.AsyncErrorCB = cb } // ErrorHandler will return the async error handler. func (nc *Conn) ErrorHandler() ErrHandler { if nc == nil { return nil } nc.mu.Lock() defer nc.mu.Unlock() return nc.Opts.AsyncErrorCB } // Process the url string argument to Connect. // Return an array of urls, even if only one. func processUrlString(url string) []string { urls := strings.Split(url, ",") var j int for _, s := range urls { u := strings.TrimSpace(s) if len(u) > 0 { urls[j] = u j++ } } return urls[:j] } // Connect will attempt to connect to a NATS server with multiple options. func (o Options) Connect() (*Conn, error) { nc := &Conn{Opts: o} // Some default options processing. if nc.Opts.MaxPingsOut == 0 { nc.Opts.MaxPingsOut = DefaultMaxPingOut } // Allow old default for channel length to work correctly. if nc.Opts.SubChanLen == 0 { nc.Opts.SubChanLen = DefaultMaxChanLen } // Default ReconnectBufSize if nc.Opts.ReconnectBufSize == 0 { nc.Opts.ReconnectBufSize = DefaultReconnectBufSize } // Ensure that Timeout is not 0 if nc.Opts.Timeout == 0 { nc.Opts.Timeout = DefaultTimeout } // Check first for user jwt callback being defined and nkey. if nc.Opts.UserJWT != nil && nc.Opts.Nkey != "" { return nil, ErrNkeyAndUser } // Check if we have an nkey but no signature callback defined. if nc.Opts.Nkey != "" && nc.Opts.SignatureCB == nil { return nil, ErrNkeyButNoSigCB } // Allow custom Dialer for connecting using a timeout by default if nc.Opts.Dialer == nil { nc.Opts.Dialer = &net.Dialer{ Timeout: nc.Opts.Timeout, } } if err := nc.setupServerPool(); err != nil { return nil, err } // Create the async callback handler. nc.ach = &asyncCallbacksHandler{} nc.ach.cond = sync.NewCond(&nc.ach.mu) // Set a default error handler that will print to stderr. if nc.Opts.AsyncErrorCB == nil { nc.Opts.AsyncErrorCB = defaultErrHandler } // Create reader/writer nc.newReaderWriter() connectionEstablished, err := nc.connect() if err != nil { return nil, err } // Spin up the async cb dispatcher on success go nc.ach.asyncCBDispatcher() if connectionEstablished && nc.Opts.ConnectedCB != nil { nc.ach.push(func() { nc.Opts.ConnectedCB(nc) }) } return nc, nil } func defaultErrHandler(nc *Conn, sub *Subscription, err error) { var cid uint64 if nc != nil { nc.mu.RLock() cid = nc.info.CID nc.mu.RUnlock() } var errStr string if sub != nil { var subject string sub.mu.Lock() if sub.jsi != nil { subject = sub.jsi.psubj } else { subject = sub.Subject } sub.mu.Unlock() errStr = fmt.Sprintf("%s on connection [%d] for subscription on %q\n", err.Error(), cid, subject) } else { errStr = fmt.Sprintf("%s on connection [%d]\n", err.Error(), cid) } os.Stderr.WriteString(errStr) } const ( _CRLF_ = "\r\n" _EMPTY_ = "" _SPC_ = " " _PUB_P_ = "PUB " _HPUB_P_ = "HPUB " ) var _CRLF_BYTES_ = []byte(_CRLF_) const ( _OK_OP_ = "+OK" _ERR_OP_ = "-ERR" _PONG_OP_ = "PONG" _INFO_OP_ = "INFO" ) const ( connectProto = "CONNECT %s" + _CRLF_ pingProto = "PING" + _CRLF_ pongProto = "PONG" + _CRLF_ subProto = "SUB %s %s %d" + _CRLF_ unsubProto = "UNSUB %d %s" + _CRLF_ okProto = _OK_OP_ + _CRLF_ ) // Return the currently selected server func (nc *Conn) currentServer() (int, *srv) { for i, s := range nc.srvPool { if s == nil { continue } if s == nc.current { return i, s } } return -1, nil } // Pop the current server and put onto the end of the list. Select head of list as long // as number of reconnect attempts under MaxReconnect. func (nc *Conn) selectNextServer() (*srv, error) { i, s := nc.currentServer() if i < 0 { return nil, ErrNoServers } sp := nc.srvPool num := len(sp) copy(sp[i:num-1], sp[i+1:num]) maxReconnect := nc.Opts.MaxReconnect if maxReconnect < 0 || s.reconnects < maxReconnect { nc.srvPool[num-1] = s } else { nc.srvPool = sp[0 : num-1] } if len(nc.srvPool) <= 0 { nc.current = nil return nil, ErrNoServers } nc.current = nc.srvPool[0] return nc.srvPool[0], nil } // Will assign the correct server to nc.current func (nc *Conn) pickServer() error { nc.current = nil if len(nc.srvPool) <= 0 { return ErrNoServers } for _, s := range nc.srvPool { if s != nil { nc.current = s return nil } } return ErrNoServers } const tlsScheme = "tls" // Create the server pool using the options given. // We will place a Url option first, followed by any // Server Options. We will randomize the server pool unless // the NoRandomize flag is set. func (nc *Conn) setupServerPool() error { nc.srvPool = make([]*srv, 0, srvPoolSize) nc.urls = make(map[string]struct{}, srvPoolSize) // Create srv objects from each url string in nc.Opts.Servers // and add them to the pool. for _, urlString := range nc.Opts.Servers { if err := nc.addURLToPool(urlString, false, false); err != nil { return err } } // Randomize if allowed to if !nc.Opts.NoRandomize { nc.shufflePool(0) } // Normally, if this one is set, Options.Servers should not be, // but we always allowed that, so continue to do so. if nc.Opts.Url != _EMPTY_ { // Add to the end of the array if err := nc.addURLToPool(nc.Opts.Url, false, false); err != nil { return err } // Then swap it with first to guarantee that Options.Url is tried first. last := len(nc.srvPool) - 1 if last > 0 { nc.srvPool[0], nc.srvPool[last] = nc.srvPool[last], nc.srvPool[0] } } else if len(nc.srvPool) <= 0 { // Place default URL if pool is empty. if err := nc.addURLToPool(DefaultURL, false, false); err != nil { return err } } // Check for Scheme hint to move to TLS mode. for _, srv := range nc.srvPool { if srv.url.Scheme == tlsScheme || srv.url.Scheme == wsSchemeTLS { // FIXME(dlc), this is for all in the pool, should be case by case. nc.Opts.Secure = true if nc.Opts.TLSConfig == nil { nc.Opts.TLSConfig = &tls.Config{MinVersion: tls.VersionTLS12} } } } return nc.pickServer() } // Helper function to return scheme func (nc *Conn) connScheme() string { if nc.ws { if nc.Opts.Secure { return wsSchemeTLS } return wsScheme } if nc.Opts.Secure { return tlsScheme } return "nats" } // Return true iff u.Hostname() is an IP address. func hostIsIP(u *url.URL) bool { return net.ParseIP(u.Hostname()) != nil } // addURLToPool adds an entry to the server pool func (nc *Conn) addURLToPool(sURL string, implicit, saveTLSName bool) error { if !strings.Contains(sURL, "://") { sURL = fmt.Sprintf("%s://%s", nc.connScheme(), sURL) } var ( u *url.URL err error ) for i := 0; i < 2; i++ { u, err = url.Parse(sURL) if err != nil { return err } if u.Port() != "" { break } // In case given URL is of the form "localhost:", just add // the port number at the end, otherwise, add ":4222". if sURL[len(sURL)-1] != ':' { sURL += ":" } switch u.Scheme { case wsScheme: sURL += defaultWSPortString case wsSchemeTLS: sURL += defaultWSSPortString default: sURL += defaultPortString } } isWS := isWebsocketScheme(u) // We don't support mix and match of websocket and non websocket URLs. // If this is the first URL, then we accept and switch the global state // to websocket. After that, we will know how to reject mixed URLs. if len(nc.srvPool) == 0 { nc.ws = isWS } else if isWS && !nc.ws || !isWS && nc.ws { return fmt.Errorf("mixing of websocket and non websocket URLs is not allowed") } var tlsName string if implicit { curl := nc.current.url // Check to see if we do not have a url.User but current connected // url does. If so copy over. if u.User == nil && curl.User != nil { u.User = curl.User } // We are checking to see if we have a secure connection and are // adding an implicit server that just has an IP. If so we will remember // the current hostname we are connected to. if saveTLSName && hostIsIP(u) { tlsName = curl.Hostname() } } s := &srv{url: u, isImplicit: implicit, tlsName: tlsName} nc.srvPool = append(nc.srvPool, s) nc.urls[u.Host] = struct{}{} return nil } // shufflePool swaps randomly elements in the server pool // The `offset` value indicates that the shuffling should start at // this offset and leave the elements from [0..offset) intact. func (nc *Conn) shufflePool(offset int) { if len(nc.srvPool) <= offset+1 { return } source := rand.NewSource(time.Now().UnixNano()) r := rand.New(source) for i := offset; i < len(nc.srvPool); i++ { j := offset + r.Intn(i+1-offset) nc.srvPool[i], nc.srvPool[j] = nc.srvPool[j], nc.srvPool[i] } } func (nc *Conn) newReaderWriter() { nc.br = &natsReader{ buf: make([]byte, defaultBufSize), off: -1, } nc.bw = &natsWriter{ limit: defaultBufSize, plimit: nc.Opts.ReconnectBufSize, } } func (nc *Conn) bindToNewConn() { bw := nc.bw bw.w, bw.bufs = nc.newWriter(), nil br := nc.br br.r, br.n, br.off = nc.conn, 0, -1 } func (nc *Conn) newWriter() io.Writer { var w io.Writer = nc.conn if nc.Opts.FlusherTimeout > 0 { w = &timeoutWriter{conn: nc.conn, timeout: nc.Opts.FlusherTimeout} } return w } func (w *natsWriter) appendString(str string) error { return w.appendBufs([]byte(str)) } func (w *natsWriter) appendBufs(bufs ...[]byte) error { for _, buf := range bufs { if len(buf) == 0 { continue } if w.pending != nil { w.pending.Write(buf) } else { w.bufs = append(w.bufs, buf...) } } if w.pending == nil && len(w.bufs) >= w.limit { return w.flush() } return nil } func (w *natsWriter) writeDirect(strs ...string) error { for _, str := range strs { if _, err := w.w.Write([]byte(str)); err != nil { return err } } return nil } func (w *natsWriter) flush() error { // If a pending buffer is set, we don't flush. Code that needs to // write directly to the socket, by-passing buffers during (re)connect, // will use the writeDirect() API. if w.pending != nil { return nil } // Do not skip calling w.w.Write() here if len(w.bufs) is 0 because // the actual writer (if websocket for instance) may have things // to do such as sending control frames, etc.. _, err := w.w.Write(w.bufs) w.bufs = w.bufs[:0] return err } func (w *natsWriter) buffered() int { if w.pending != nil { return w.pending.Len() } return len(w.bufs) } func (w *natsWriter) switchToPending() { w.pending = new(bytes.Buffer) } func (w *natsWriter) flushPendingBuffer() error { if w.pending == nil || w.pending.Len() == 0 { return nil } _, err := w.w.Write(w.pending.Bytes()) // Reset the pending buffer at this point because we don't want // to take the risk of sending duplicates or partials. w.pending.Reset() return err } func (w *natsWriter) atLimitIfUsingPending() bool { if w.pending == nil { return false } return w.pending.Len() >= w.plimit } func (w *natsWriter) doneWithPending() { w.pending = nil } // Notify the reader that we are done with the connect, where "read" operations // happen synchronously and under the connection lock. After this point, "read" // will be happening from the read loop, without the connection lock. // // Note: this runs under the connection lock. func (r *natsReader) doneWithConnect() { if wsr, ok := r.r.(*websocketReader); ok { wsr.doneWithConnect() } } func (r *natsReader) Read() ([]byte, error) { if r.off >= 0 { off := r.off r.off = -1 return r.buf[off:r.n], nil } var err error r.n, err = r.r.Read(r.buf) return r.buf[:r.n], err } func (r *natsReader) ReadString(delim byte) (string, error) { var s string build_string: // First look if we have something in the buffer if r.off >= 0 { i := bytes.IndexByte(r.buf[r.off:r.n], delim) if i >= 0 { end := r.off + i + 1 s += string(r.buf[r.off:end]) r.off = end if r.off >= r.n { r.off = -1 } return s, nil } // We did not find the delim, so will have to read more. s += string(r.buf[r.off:r.n]) r.off = -1 } if _, err := r.Read(); err != nil { return s, err } r.off = 0 goto build_string } // createConn will connect to the server and wrap the appropriate // bufio structures. It will do the right thing when an existing // connection is in place. func (nc *Conn) createConn() (err error) { if nc.Opts.Timeout < 0 { return ErrBadTimeout } if _, cur := nc.currentServer(); cur == nil { return ErrNoServers } // If we have a reference to an in-process server then establish a // connection using that. if nc.Opts.InProcessServer != nil { conn, err := nc.Opts.InProcessServer.InProcessConn() if err != nil { return fmt.Errorf("failed to get in-process connection: %w", err) } nc.conn = conn nc.bindToNewConn() return nil } // We will auto-expand host names if they resolve to multiple IPs hosts := []string{} u := nc.current.url if !nc.Opts.SkipHostLookup && net.ParseIP(u.Hostname()) == nil { addrs, _ := net.LookupHost(u.Hostname()) for _, addr := range addrs { hosts = append(hosts, net.JoinHostPort(addr, u.Port())) } } // Fall back to what we were given. if len(hosts) == 0 { hosts = append(hosts, u.Host) } // CustomDialer takes precedence. If not set, use Opts.Dialer which // is set to a default *net.Dialer (in Connect()) if not explicitly // set by the user. dialer := nc.Opts.CustomDialer if dialer == nil { // We will copy and shorten the timeout if we have multiple hosts to try. copyDialer := *nc.Opts.Dialer copyDialer.Timeout = copyDialer.Timeout / time.Duration(len(hosts)) dialer = ©Dialer } if len(hosts) > 1 && !nc.Opts.NoRandomize { rand.Shuffle(len(hosts), func(i, j int) { hosts[i], hosts[j] = hosts[j], hosts[i] }) } for _, host := range hosts { nc.conn, err = dialer.Dial("tcp", host) if err == nil { break } } if err != nil { return err } // If scheme starts with "ws" then branch out to websocket code. if isWebsocketScheme(u) { return nc.wsInitHandshake(u) } // Reset reader/writer to this new TCP connection nc.bindToNewConn() return nil } type skipTLSDialer interface { SkipTLSHandshake() bool } // makeTLSConn will wrap an existing Conn using TLS func (nc *Conn) makeTLSConn() error { if nc.Opts.CustomDialer != nil { // we do nothing when asked to skip the TLS wrapper sd, ok := nc.Opts.CustomDialer.(skipTLSDialer) if ok && sd.SkipTLSHandshake() { return nil } } // Allow the user to configure their own tls.Config structure. tlsCopy := &tls.Config{} if nc.Opts.TLSConfig != nil { tlsCopy = util.CloneTLSConfig(nc.Opts.TLSConfig) } if nc.Opts.TLSCertCB != nil { cert, err := nc.Opts.TLSCertCB() if err != nil { return err } tlsCopy.Certificates = []tls.Certificate{cert} } if nc.Opts.RootCAsCB != nil { rootCAs, err := nc.Opts.RootCAsCB() if err != nil { return err } tlsCopy.RootCAs = rootCAs } // If its blank we will override it with the current host if tlsCopy.ServerName == _EMPTY_ { if nc.current.tlsName != _EMPTY_ { tlsCopy.ServerName = nc.current.tlsName } else { h, _, _ := net.SplitHostPort(nc.current.url.Host) tlsCopy.ServerName = h } } nc.conn = tls.Client(nc.conn, tlsCopy) conn := nc.conn.(*tls.Conn) if err := conn.Handshake(); err != nil { return err } nc.bindToNewConn() return nil } // TLSConnectionState retrieves the state of the TLS connection to the server func (nc *Conn) TLSConnectionState() (tls.ConnectionState, error) { if !nc.isConnected() { return tls.ConnectionState{}, ErrDisconnected } nc.mu.RLock() conn := nc.conn nc.mu.RUnlock() tc, ok := conn.(*tls.Conn) if !ok { return tls.ConnectionState{}, ErrConnectionNotTLS } return tc.ConnectionState(), nil } // waitForExits will wait for all socket watcher Go routines to // be shutdown before proceeding. func (nc *Conn) waitForExits() { // Kick old flusher forcefully. select { case nc.fch <- struct{}{}: default: } // Wait for any previous go routines. nc.wg.Wait() } // ConnectedUrl reports the connected server's URL func (nc *Conn) ConnectedUrl() string { if nc == nil { return _EMPTY_ } nc.mu.RLock() defer nc.mu.RUnlock() if nc.status != CONNECTED { return _EMPTY_ } return nc.current.url.String() } // ConnectedUrlRedacted reports the connected server's URL with passwords redacted func (nc *Conn) ConnectedUrlRedacted() string { if nc == nil { return _EMPTY_ } nc.mu.RLock() defer nc.mu.RUnlock() if nc.status != CONNECTED { return _EMPTY_ } return nc.current.url.Redacted() } // ConnectedAddr returns the connected server's IP func (nc *Conn) ConnectedAddr() string { if nc == nil { return _EMPTY_ } nc.mu.RLock() defer nc.mu.RUnlock() if nc.status != CONNECTED { return _EMPTY_ } return nc.conn.RemoteAddr().String() } // ConnectedServerId reports the connected server's Id func (nc *Conn) ConnectedServerId() string { if nc == nil { return _EMPTY_ } nc.mu.RLock() defer nc.mu.RUnlock() if nc.status != CONNECTED { return _EMPTY_ } return nc.info.ID } // ConnectedServerName reports the connected server's name func (nc *Conn) ConnectedServerName() string { if nc == nil { return _EMPTY_ } nc.mu.RLock() defer nc.mu.RUnlock() if nc.status != CONNECTED { return _EMPTY_ } return nc.info.Name } var semVerRe = regexp.MustCompile(`\Av?([0-9]+)\.?([0-9]+)?\.?([0-9]+)?`) func versionComponents(version string) (major, minor, patch int, err error) { m := semVerRe.FindStringSubmatch(version) if m == nil { return 0, 0, 0, errors.New("invalid semver") } major, err = strconv.Atoi(m[1]) if err != nil { return -1, -1, -1, err } minor, err = strconv.Atoi(m[2]) if err != nil { return -1, -1, -1, err } patch, err = strconv.Atoi(m[3]) if err != nil { return -1, -1, -1, err } return major, minor, patch, err } // Check for minimum server requirement. func (nc *Conn) serverMinVersion(major, minor, patch int) bool { smajor, sminor, spatch, _ := versionComponents(nc.ConnectedServerVersion()) if smajor < major || (smajor == major && sminor < minor) || (smajor == major && sminor == minor && spatch < patch) { return false } return true } // ConnectedServerVersion reports the connected server's version as a string func (nc *Conn) ConnectedServerVersion() string { if nc == nil { return _EMPTY_ } nc.mu.RLock() defer nc.mu.RUnlock() if nc.status != CONNECTED { return _EMPTY_ } return nc.info.Version } // ConnectedClusterName reports the connected server's cluster name if any func (nc *Conn) ConnectedClusterName() string { if nc == nil { return _EMPTY_ } nc.mu.RLock() defer nc.mu.RUnlock() if nc.status != CONNECTED { return _EMPTY_ } return nc.info.Cluster } // Low level setup for structs, etc func (nc *Conn) setup() { nc.subs = make(map[int64]*Subscription) nc.pongs = make([]chan struct{}, 0, 8) nc.fch = make(chan struct{}, flushChanSize) nc.rqch = make(chan struct{}) // Setup scratch outbound buffer for PUB/HPUB pub := nc.scratch[:len(_HPUB_P_)] copy(pub, _HPUB_P_) } // Process a connected connection and initialize properly. func (nc *Conn) processConnectInit() error { // Set our deadline for the whole connect process nc.conn.SetDeadline(time.Now().Add(nc.Opts.Timeout)) defer nc.conn.SetDeadline(time.Time{}) // Set our status to connecting. nc.changeConnStatus(CONNECTING) // Process the INFO protocol received from the server err := nc.processExpectedInfo() if err != nil { return err } // Send the CONNECT protocol along with the initial PING protocol. // Wait for the PONG response (or any error that we get from the server). err = nc.sendConnect() if err != nil { return err } // Reset the number of PING sent out nc.pout = 0 // Start or reset Timer if nc.Opts.PingInterval > 0 { if nc.ptmr == nil { nc.ptmr = time.AfterFunc(nc.Opts.PingInterval, nc.processPingTimer) } else { nc.ptmr.Reset(nc.Opts.PingInterval) } } // Start the readLoop and flusher go routines, we will wait on both on a reconnect event. nc.wg.Add(2) go nc.readLoop() go nc.flusher() // Notify the reader that we are done with the connect handshake, where // reads were done synchronously and under the connection lock. nc.br.doneWithConnect() return nil } // Main connect function. Will connect to the nats-server. func (nc *Conn) connect() (bool, error) { var err error var connectionEstablished bool // Create actual socket connection // For first connect we walk all servers in the pool and try // to connect immediately. nc.mu.Lock() defer nc.mu.Unlock() nc.initc = true // The pool may change inside the loop iteration due to INFO protocol. for i := 0; i < len(nc.srvPool); i++ { nc.current = nc.srvPool[i] if err = nc.createConn(); err == nil { // This was moved out of processConnectInit() because // that function is now invoked from doReconnect() too. nc.setup() err = nc.processConnectInit() if err == nil { nc.current.didConnect = true nc.current.reconnects = 0 nc.current.lastErr = nil break } else { nc.mu.Unlock() nc.close(DISCONNECTED, false, err) nc.mu.Lock() // Do not reset nc.current here since it would prevent // RetryOnFailedConnect to work should this be the last server // to try before starting doReconnect(). } } else { // Cancel out default connection refused, will trigger the // No servers error conditional if strings.Contains(err.Error(), "connection refused") { err = nil } } } if err == nil && nc.status != CONNECTED { err = ErrNoServers } if err == nil { connectionEstablished = true nc.initc = false } else if nc.Opts.RetryOnFailedConnect { nc.setup() nc.changeConnStatus(RECONNECTING) nc.bw.switchToPending() go nc.doReconnect(ErrNoServers) err = nil } else { nc.current = nil } return connectionEstablished, err } // This will check to see if the connection should be // secure. This can be dictated from either end and should // only be called after the INIT protocol has been received. func (nc *Conn) checkForSecure() error { // Check to see if we need to engage TLS o := nc.Opts // Check for mismatch in setups if o.Secure && !nc.info.TLSRequired && !nc.info.TLSAvailable { return ErrSecureConnWanted } else if nc.info.TLSRequired && !o.Secure { // Switch to Secure since server needs TLS. o.Secure = true } // Need to rewrap with bufio if o.Secure { if err := nc.makeTLSConn(); err != nil { return err } } return nil } // processExpectedInfo will look for the expected first INFO message // sent when a connection is established. The lock should be held entering. func (nc *Conn) processExpectedInfo() error { c := &control{} // Read the protocol err := nc.readOp(c) if err != nil { return err } // The nats protocol should send INFO first always. if c.op != _INFO_OP_ { return ErrNoInfoReceived } // Parse the protocol if err := nc.processInfo(c.args); err != nil { return err } if nc.Opts.Nkey != "" && nc.info.Nonce == "" { return ErrNkeysNotSupported } // For websocket connections, we already switched to TLS if need be, // so we are done here. if nc.ws { return nil } return nc.checkForSecure() } // Sends a protocol control message by queuing into the bufio writer // and kicking the flush Go routine. These writes are protected. func (nc *Conn) sendProto(proto string) { nc.mu.Lock() nc.bw.appendString(proto) nc.kickFlusher() nc.mu.Unlock() } // Generate a connect protocol message, issuing user/password if // applicable. The lock is assumed to be held upon entering. func (nc *Conn) connectProto() (string, error) { o := nc.Opts var nkey, sig, user, pass, token, ujwt string u := nc.current.url.User if u != nil { // if no password, assume username is authToken if _, ok := u.Password(); !ok { token = u.Username() } else { user = u.Username() pass, _ = u.Password() } } else { // Take from options (possibly all empty strings) user = o.User pass = o.Password token = o.Token nkey = o.Nkey } // Look for user jwt. if o.UserJWT != nil { if jwt, err := o.UserJWT(); err != nil { return _EMPTY_, err } else { ujwt = jwt } if nkey != _EMPTY_ { return _EMPTY_, ErrNkeyAndUser } } if ujwt != _EMPTY_ || nkey != _EMPTY_ { if o.SignatureCB == nil { if ujwt == _EMPTY_ { return _EMPTY_, ErrNkeyButNoSigCB } return _EMPTY_, ErrUserButNoSigCB } sigraw, err := o.SignatureCB([]byte(nc.info.Nonce)) if err != nil { return _EMPTY_, fmt.Errorf("error signing nonce: %w", err) } sig = base64.RawURLEncoding.EncodeToString(sigraw) } if nc.Opts.TokenHandler != nil { if token != _EMPTY_ { return _EMPTY_, ErrTokenAlreadySet } token = nc.Opts.TokenHandler() } // If our server does not support headers then we can't do them or no responders. hdrs := nc.info.Headers cinfo := connectInfo{o.Verbose, o.Pedantic, ujwt, nkey, sig, user, pass, token, o.Secure, o.Name, LangString, Version, clientProtoInfo, !o.NoEcho, hdrs, hdrs} b, err := json.Marshal(cinfo) if err != nil { return _EMPTY_, ErrJsonParse } // Check if NoEcho is set and we have a server that supports it. if o.NoEcho && nc.info.Proto < 1 { return _EMPTY_, ErrNoEchoNotSupported } return fmt.Sprintf(connectProto, b), nil } // normalizeErr removes the prefix -ERR, trim spaces and remove the quotes. func normalizeErr(line string) string { s := strings.TrimSpace(strings.TrimPrefix(line, _ERR_OP_)) s = strings.TrimLeft(strings.TrimRight(s, "'"), "'") return s } // natsProtoErr represents an -ERR protocol message sent by the server. type natsProtoErr struct { description string } func (nerr *natsProtoErr) Error() string { return fmt.Sprintf("nats: %s", nerr.description) } func (nerr *natsProtoErr) Is(err error) bool { return strings.ToLower(nerr.Error()) == err.Error() } // Send a connect protocol message to the server, issue user/password if // applicable. Will wait for a flush to return from the server for error // processing. func (nc *Conn) sendConnect() error { // Construct the CONNECT protocol string cProto, err := nc.connectProto() if err != nil { return err } // Write the protocol and PING directly to the underlying writer. if err := nc.bw.writeDirect(cProto, pingProto); err != nil { return err } // We don't want to read more than we need here, otherwise // we would need to transfer the excess read data to the readLoop. // Since in normal situations we just are looking for a PONG\r\n, // reading byte-by-byte here is ok. proto, err := nc.readProto() if err != nil { if !nc.initc && nc.Opts.AsyncErrorCB != nil { nc.ach.push(func() { nc.Opts.AsyncErrorCB(nc, nil, err) }) } return err } // If opts.Verbose is set, handle +OK if nc.Opts.Verbose && proto == okProto { // Read the rest now... proto, err = nc.readProto() if err != nil { if !nc.initc && nc.Opts.AsyncErrorCB != nil { nc.ach.push(func() { nc.Opts.AsyncErrorCB(nc, nil, err) }) } return err } } // We expect a PONG if proto != pongProto { // But it could be something else, like -ERR // Since we no longer use ReadLine(), trim the trailing "\r\n" proto = strings.TrimRight(proto, "\r\n") // If it's a server error... if strings.HasPrefix(proto, _ERR_OP_) { // Remove -ERR, trim spaces and quotes, and convert to lower case. proto = normalizeErr(proto) // Check if this is an auth error if authErr := checkAuthError(strings.ToLower(proto)); authErr != nil { // This will schedule an async error if we are in reconnect, // and keep track of the auth error for the current server. // If we have got the same error twice, this sets nc.ar to true to // indicate that the reconnect should be aborted (will be checked // in doReconnect()). nc.processAuthError(authErr) } return &natsProtoErr{proto} } // Notify that we got an unexpected protocol. return fmt.Errorf("nats: expected '%s', got '%s'", _PONG_OP_, proto) } // This is where we are truly connected. nc.changeConnStatus(CONNECTED) return nil } // reads a protocol line. func (nc *Conn) readProto() (string, error) { return nc.br.ReadString('\n') } // A control protocol line. type control struct { op, args string } // Read a control line and process the intended op. func (nc *Conn) readOp(c *control) error { line, err := nc.readProto() if err != nil { return err } parseControl(line, c) return nil } // Parse a control line from the server. func parseControl(line string, c *control) { toks := strings.SplitN(line, _SPC_, 2) if len(toks) == 1 { c.op = strings.TrimSpace(toks[0]) c.args = _EMPTY_ } else if len(toks) == 2 { c.op, c.args = strings.TrimSpace(toks[0]), strings.TrimSpace(toks[1]) } else { c.op = _EMPTY_ } } // flushReconnectPendingItems will push the pending items that were // gathered while we were in a RECONNECTING state to the socket. func (nc *Conn) flushReconnectPendingItems() error { return nc.bw.flushPendingBuffer() } // Stops the ping timer if set. // Connection lock is held on entry. func (nc *Conn) stopPingTimer() { if nc.ptmr != nil { nc.ptmr.Stop() } } // Try to reconnect using the option parameters. // This function assumes we are allowed to reconnect. func (nc *Conn) doReconnect(err error) { // We want to make sure we have the other watchers shutdown properly // here before we proceed past this point. nc.waitForExits() // FIXME(dlc) - We have an issue here if we have // outstanding flush points (pongs) and they were not // sent out, but are still in the pipe. // Hold the lock manually and release where needed below, // can't do defer here. nc.mu.Lock() // Clear any errors. nc.err = nil // Perform appropriate callback if needed for a disconnect. // DisconnectedErrCB has priority over deprecated DisconnectedCB if !nc.initc { if nc.Opts.DisconnectedErrCB != nil { nc.ach.push(func() { nc.Opts.DisconnectedErrCB(nc, err) }) } else if nc.Opts.DisconnectedCB != nil { nc.ach.push(func() { nc.Opts.DisconnectedCB(nc) }) } } // This is used to wait on go routines exit if we start them in the loop // but an error occurs after that. waitForGoRoutines := false var rt *time.Timer // Channel used to kick routine out of sleep when conn is closed. rqch := nc.rqch // Counter that is increased when the whole list of servers has been tried. var wlf int var jitter time.Duration var rw time.Duration // If a custom reconnect delay handler is set, this takes precedence. crd := nc.Opts.CustomReconnectDelayCB if crd == nil { rw = nc.Opts.ReconnectWait // TODO: since we sleep only after the whole list has been tried, we can't // rely on individual *srv to know if it is a TLS or non-TLS url. // We have to pick which type of jitter to use, for now, we use these hints: jitter = nc.Opts.ReconnectJitter if nc.Opts.Secure || nc.Opts.TLSConfig != nil { jitter = nc.Opts.ReconnectJitterTLS } } for i := 0; len(nc.srvPool) > 0; { cur, err := nc.selectNextServer() if err != nil { nc.err = err break } doSleep := i+1 >= len(nc.srvPool) nc.mu.Unlock() if !doSleep { i++ // Release the lock to give a chance to a concurrent nc.Close() to break the loop. runtime.Gosched() } else { i = 0 var st time.Duration if crd != nil { wlf++ st = crd(wlf) } else { st = rw if jitter > 0 { st += time.Duration(rand.Int63n(int64(jitter))) } } if rt == nil { rt = time.NewTimer(st) } else { rt.Reset(st) } select { case <-rqch: rt.Stop() case <-rt.C: } } // If the readLoop, etc.. go routines were started, wait for them to complete. if waitForGoRoutines { nc.waitForExits() waitForGoRoutines = false } nc.mu.Lock() // Check if we have been closed first. if nc.isClosed() { break } // Mark that we tried a reconnect cur.reconnects++ // Try to create a new connection err = nc.createConn() // Not yet connected, retry... // Continue to hold the lock if err != nil { nc.err = nil continue } // We are reconnected nc.Reconnects++ // Process connect logic if nc.err = nc.processConnectInit(); nc.err != nil { // Check if we should abort reconnect. If so, break out // of the loop and connection will be closed. if nc.ar { break } nc.changeConnStatus(RECONNECTING) continue } // Clear possible lastErr under the connection lock after // a successful processConnectInit(). nc.current.lastErr = nil // Clear out server stats for the server we connected to.. cur.didConnect = true cur.reconnects = 0 // Send existing subscription state nc.resendSubscriptions() // Now send off and clear pending buffer nc.err = nc.flushReconnectPendingItems() if nc.err != nil { nc.changeConnStatus(RECONNECTING) // Stop the ping timer (if set) nc.stopPingTimer() // Since processConnectInit() returned without error, the // go routines were started, so wait for them to return // on the next iteration (after releasing the lock). waitForGoRoutines = true continue } // Done with the pending buffer nc.bw.doneWithPending() // This is where we are truly connected. nc.status = CONNECTED // If we are here with a retry on failed connect, indicate that the // initial connect is now complete. nc.initc = false // Queue up the reconnect callback. if nc.Opts.ReconnectedCB != nil { nc.ach.push(func() { nc.Opts.ReconnectedCB(nc) }) } // Release lock here, we will return below. nc.mu.Unlock() // Make sure to flush everything nc.Flush() return } // Call into close.. We have no servers left.. if nc.err == nil { nc.err = ErrNoServers } nc.mu.Unlock() nc.close(CLOSED, true, nil) } // processOpErr handles errors from reading or parsing the protocol. // The lock should not be held entering this function. func (nc *Conn) processOpErr(err error) { nc.mu.Lock() if nc.isConnecting() || nc.isClosed() || nc.isReconnecting() { nc.mu.Unlock() return } if nc.Opts.AllowReconnect && nc.status == CONNECTED { // Set our new status nc.changeConnStatus(RECONNECTING) // Stop ping timer if set nc.stopPingTimer() if nc.conn != nil { nc.conn.Close() nc.conn = nil } // Create pending buffer before reconnecting. nc.bw.switchToPending() // Clear any queued pongs, e.g. pending flush calls. nc.clearPendingFlushCalls() go nc.doReconnect(err) nc.mu.Unlock() return } nc.changeConnStatus(DISCONNECTED) nc.err = err nc.mu.Unlock() nc.close(CLOSED, true, nil) } // dispatch is responsible for calling any async callbacks func (ac *asyncCallbacksHandler) asyncCBDispatcher() { for { ac.mu.Lock() // Protect for spurious wakeups. We should get out of the // wait only if there is an element to pop from the list. for ac.head == nil { ac.cond.Wait() } cur := ac.head ac.head = cur.next if cur == ac.tail { ac.tail = nil } ac.mu.Unlock() // This signals that the dispatcher has been closed and all // previous callbacks have been dispatched. if cur.f == nil { return } // Invoke callback outside of handler's lock cur.f() } } // Add the given function to the tail of the list and // signals the dispatcher. func (ac *asyncCallbacksHandler) push(f func()) { ac.pushOrClose(f, false) } // Signals that we are closing... func (ac *asyncCallbacksHandler) close() { ac.pushOrClose(nil, true) } // Add the given function to the tail of the list and // signals the dispatcher. func (ac *asyncCallbacksHandler) pushOrClose(f func(), close bool) { ac.mu.Lock() defer ac.mu.Unlock() // Make sure that library is not calling push with nil function, // since this is used to notify the dispatcher that it should stop. if !close && f == nil { panic("pushing a nil callback") } cb := &asyncCB{f: f} if ac.tail != nil { ac.tail.next = cb } else { ac.head = cb } ac.tail = cb if close { ac.cond.Broadcast() } else { ac.cond.Signal() } } // readLoop() will sit on the socket reading and processing the // protocol from the server. It will dispatch appropriately based // on the op type. func (nc *Conn) readLoop() { // Release the wait group on exit defer nc.wg.Done() // Create a parseState if needed. nc.mu.Lock() if nc.ps == nil { nc.ps = &parseState{} } conn := nc.conn br := nc.br nc.mu.Unlock() if conn == nil { return } for { buf, err := br.Read() if err == nil { // With websocket, it is possible that there is no error but // also no buffer returned (either WS control message or read of a // partial compressed message). We could call parse(buf) which // would ignore an empty buffer, but simply go back to top of the loop. if len(buf) == 0 { continue } err = nc.parse(buf) } if err != nil { nc.processOpErr(err) break } } // Clear the parseState here.. nc.mu.Lock() nc.ps = nil nc.mu.Unlock() } // waitForMsgs waits on the conditional shared with readLoop and processMsg. // It is used to deliver messages to asynchronous subscribers. func (nc *Conn) waitForMsgs(s *Subscription) { var closed bool var delivered, max uint64 // Used to account for adjustments to sub.pBytes when we wrap back around. msgLen := -1 for { s.mu.Lock() // Do accounting for last msg delivered here so we only lock once // and drain state trips after callback has returned. if msgLen >= 0 { s.pMsgs-- s.pBytes -= msgLen msgLen = -1 } if s.pHead == nil && !s.closed { s.pCond.Wait() } // Pop the msg off the list m := s.pHead if m != nil { s.pHead = m.next if s.pHead == nil { s.pTail = nil } if m.barrier != nil { s.mu.Unlock() if atomic.AddInt64(&m.barrier.refs, -1) == 0 { m.barrier.f() } continue } msgLen = len(m.Data) } mcb := s.mcb max = s.max closed = s.closed var fcReply string if !s.closed { s.delivered++ delivered = s.delivered if s.jsi != nil { fcReply = s.checkForFlowControlResponse() } } s.mu.Unlock() // Respond to flow control if applicable if fcReply != _EMPTY_ { nc.Publish(fcReply, nil) } if closed { break } // Deliver the message. if m != nil && (max == 0 || delivered <= max) { mcb(m) } // If we have hit the max for delivered msgs, remove sub. if max > 0 && delivered >= max { nc.mu.Lock() nc.removeSub(s) nc.mu.Unlock() break } } // Check for barrier messages s.mu.Lock() for m := s.pHead; m != nil; m = s.pHead { if m.barrier != nil { s.mu.Unlock() if atomic.AddInt64(&m.barrier.refs, -1) == 0 { m.barrier.f() } s.mu.Lock() } s.pHead = m.next } // Now check for pDone done := s.pDone s.mu.Unlock() if done != nil { done() } } // Used for debugging and simulating loss for certain tests. // Return what is to be used. If we return nil the message will be dropped. type msgFilter func(m *Msg) *Msg func (nc *Conn) addMsgFilter(subject string, filter msgFilter) { nc.subsMu.Lock() defer nc.subsMu.Unlock() if nc.filters == nil { nc.filters = make(map[string]msgFilter) } nc.filters[subject] = filter } func (nc *Conn) removeMsgFilter(subject string) { nc.subsMu.Lock() defer nc.subsMu.Unlock() if nc.filters != nil { delete(nc.filters, subject) if len(nc.filters) == 0 { nc.filters = nil } } } // processMsg is called by parse and will place the msg on the // appropriate channel/pending queue for processing. If the channel is full, // or the pending queue is over the pending limits, the connection is // considered a slow consumer. func (nc *Conn) processMsg(data []byte) { // Stats atomic.AddUint64(&nc.InMsgs, 1) atomic.AddUint64(&nc.InBytes, uint64(len(data))) // Don't lock the connection to avoid server cutting us off if the // flusher is holding the connection lock, trying to send to the server // that is itself trying to send data to us. nc.subsMu.RLock() sub := nc.subs[nc.ps.ma.sid] var mf msgFilter if nc.filters != nil { mf = nc.filters[string(nc.ps.ma.subject)] } nc.subsMu.RUnlock() if sub == nil { return } // Copy them into string subj := string(nc.ps.ma.subject) reply := string(nc.ps.ma.reply) // Doing message create outside of the sub's lock to reduce contention. // It's possible that we end-up not using the message, but that's ok. // FIXME(dlc): Need to copy, should/can do COW? var msgPayload = data if !nc.ps.msgCopied { msgPayload = make([]byte, len(data)) copy(msgPayload, data) } // Check if we have headers encoded here. var h Header var err error var ctrlMsg bool var ctrlType int var fcReply string if nc.ps.ma.hdr > 0 { hbuf := msgPayload[:nc.ps.ma.hdr] msgPayload = msgPayload[nc.ps.ma.hdr:] h, err = DecodeHeadersMsg(hbuf) if err != nil { // We will pass the message through but send async error. nc.mu.Lock() nc.err = ErrBadHeaderMsg if nc.Opts.AsyncErrorCB != nil { nc.ach.push(func() { nc.Opts.AsyncErrorCB(nc, sub, ErrBadHeaderMsg) }) } nc.mu.Unlock() } } // FIXME(dlc): Should we recycle these containers? m := &Msg{ Subject: subj, Reply: reply, Header: h, Data: msgPayload, Sub: sub, wsz: len(data) + len(subj) + len(reply), } // Check for message filters. if mf != nil { if m = mf(m); m == nil { // Drop message. return } } sub.mu.Lock() // Check if closed. if sub.closed { sub.mu.Unlock() return } // Skip flow control messages in case of using a JetStream context. jsi := sub.jsi if jsi != nil { // There has to be a header for it to be a control message. if h != nil { ctrlMsg, ctrlType = isJSControlMessage(m) if ctrlMsg && ctrlType == jsCtrlHB { // Check if the heartbeat has a "Consumer Stalled" header, if // so, the value is the FC reply to send a nil message to. // We will send it at the end of this function. fcReply = m.Header.Get(consumerStalledHdr) } } // Check for ordered consumer here. If checkOrderedMsgs returns true that means it detected a gap. if !ctrlMsg && jsi.ordered && sub.checkOrderedMsgs(m) { sub.mu.Unlock() return } } // Skip processing if this is a control message. if !ctrlMsg { var chanSubCheckFC bool // Subscription internal stats (applicable only for non ChanSubscription's) if sub.typ != ChanSubscription { sub.pMsgs++ if sub.pMsgs > sub.pMsgsMax { sub.pMsgsMax = sub.pMsgs } sub.pBytes += len(m.Data) if sub.pBytes > sub.pBytesMax { sub.pBytesMax = sub.pBytes } // Check for a Slow Consumer if (sub.pMsgsLimit > 0 && sub.pMsgs > sub.pMsgsLimit) || (sub.pBytesLimit > 0 && sub.pBytes > sub.pBytesLimit) { goto slowConsumer } } else if jsi != nil { chanSubCheckFC = true } // We have two modes of delivery. One is the channel, used by channel // subscribers and syncSubscribers, the other is a linked list for async. if sub.mch != nil { select { case sub.mch <- m: default: goto slowConsumer } } else { // Push onto the async pList if sub.pHead == nil { sub.pHead = m sub.pTail = m if sub.pCond != nil { sub.pCond.Signal() } } else { sub.pTail.next = m sub.pTail = m } } if jsi != nil { // Store the ACK metadata from the message to // compare later on with the received heartbeat. sub.trackSequences(m.Reply) if chanSubCheckFC { // For ChanSubscription, since we can't call this when a message // is "delivered" (since user is pull from their own channel), // we have a go routine that does this check, however, we do it // also here to make it much more responsive. The go routine is // really to avoid stalling when there is no new messages coming. fcReply = sub.checkForFlowControlResponse() } } } else if ctrlType == jsCtrlFC && m.Reply != _EMPTY_ { // This is a flow control message. // We will schedule the send of the FC reply once we have delivered the // DATA message that was received before this flow control message, which // has sequence `jsi.fciseq`. However, it is possible that this message // has already been delivered, in that case, we need to send the FC reply now. if sub.getJSDelivered() >= jsi.fciseq { fcReply = m.Reply } else { // Schedule a reply after the previous message is delivered. sub.scheduleFlowControlResponse(m.Reply) } } // Clear any SlowConsumer status. sub.sc = false sub.mu.Unlock() if fcReply != _EMPTY_ { nc.Publish(fcReply, nil) } // Handle control heartbeat messages. if ctrlMsg && ctrlType == jsCtrlHB && m.Reply == _EMPTY_ { nc.checkForSequenceMismatch(m, sub, jsi) } return slowConsumer: sub.dropped++ sc := !sub.sc sub.sc = true // Undo stats from above if sub.typ != ChanSubscription { sub.pMsgs-- sub.pBytes -= len(m.Data) } sub.mu.Unlock() if sc { // Now we need connection's lock and we may end-up in the situation // that we were trying to avoid, except that in this case, the client // is already experiencing client-side slow consumer situation. nc.mu.Lock() nc.err = ErrSlowConsumer if nc.Opts.AsyncErrorCB != nil { nc.ach.push(func() { nc.Opts.AsyncErrorCB(nc, sub, ErrSlowConsumer) }) } nc.mu.Unlock() } } // processPermissionsViolation is called when the server signals a subject // permissions violation on either publish or subscribe. func (nc *Conn) processPermissionsViolation(err string) { nc.mu.Lock() // create error here so we can pass it as a closure to the async cb dispatcher. e := errors.New("nats: " + err) nc.err = e if nc.Opts.AsyncErrorCB != nil { nc.ach.push(func() { nc.Opts.AsyncErrorCB(nc, nil, e) }) } nc.mu.Unlock() } // processAuthError generally processing for auth errors. We want to do retries // unless we get the same error again. This allows us for instance to swap credentials // and have the app reconnect, but if nothing is changing we should bail. // This function will return true if the connection should be closed, false otherwise. // Connection lock is held on entry func (nc *Conn) processAuthError(err error) bool { nc.err = err if !nc.initc && nc.Opts.AsyncErrorCB != nil { nc.ach.push(func() { nc.Opts.AsyncErrorCB(nc, nil, err) }) } // We should give up if we tried twice on this server and got the // same error. This behavior can be modified using IgnoreAuthErrorAbort. if nc.current.lastErr == err && !nc.Opts.IgnoreAuthErrorAbort { nc.ar = true } else { nc.current.lastErr = err } return nc.ar } // flusher is a separate Go routine that will process flush requests for the write // bufio. This allows coalescing of writes to the underlying socket. func (nc *Conn) flusher() { // Release the wait group defer nc.wg.Done() // snapshot the bw and conn since they can change from underneath of us. nc.mu.Lock() bw := nc.bw conn := nc.conn fch := nc.fch nc.mu.Unlock() if conn == nil || bw == nil { return } for { if _, ok := <-fch; !ok { return } nc.mu.Lock() // Check to see if we should bail out. if !nc.isConnected() || nc.isConnecting() || conn != nc.conn { nc.mu.Unlock() return } if bw.buffered() > 0 { if err := bw.flush(); err != nil { if nc.err == nil { nc.err = err } if nc.Opts.AsyncErrorCB != nil { nc.ach.push(func() { nc.Opts.AsyncErrorCB(nc, nil, err) }) } } } nc.mu.Unlock() } } // processPing will send an immediate pong protocol response to the // server. The server uses this mechanism to detect dead clients. func (nc *Conn) processPing() { nc.sendProto(pongProto) } // processPong is used to process responses to the client's ping // messages. We use pings for the flush mechanism as well. func (nc *Conn) processPong() { var ch chan struct{} nc.mu.Lock() if len(nc.pongs) > 0 { ch = nc.pongs[0] nc.pongs = append(nc.pongs[:0], nc.pongs[1:]...) } nc.pout = 0 nc.mu.Unlock() if ch != nil { ch <- struct{}{} } } // processOK is a placeholder for processing OK messages. func (nc *Conn) processOK() { // do nothing } // processInfo is used to parse the info messages sent // from the server. // This function may update the server pool. func (nc *Conn) processInfo(info string) error { if info == _EMPTY_ { return nil } var ncInfo serverInfo if err := json.Unmarshal([]byte(info), &ncInfo); err != nil { return err } // Copy content into connection's info structure. nc.info = ncInfo // The array could be empty/not present on initial connect, // if advertise is disabled on that server, or servers that // did not include themselves in the async INFO protocol. // If empty, do not remove the implicit servers from the pool. if len(nc.info.ConnectURLs) == 0 { if !nc.initc && ncInfo.LameDuckMode && nc.Opts.LameDuckModeHandler != nil { nc.ach.push(func() { nc.Opts.LameDuckModeHandler(nc) }) } return nil } // Note about pool randomization: when the pool was first created, // it was randomized (if allowed). We keep the order the same (removing // implicit servers that are no longer sent to us). New URLs are sent // to us in no specific order so don't need extra randomization. hasNew := false // This is what we got from the server we are connected to. urls := nc.info.ConnectURLs // Transform that to a map for easy lookups tmp := make(map[string]struct{}, len(urls)) for _, curl := range urls { tmp[curl] = struct{}{} } // Walk the pool and removed the implicit servers that are no longer in the // given array/map sp := nc.srvPool for i := 0; i < len(sp); i++ { srv := sp[i] curl := srv.url.Host // Check if this URL is in the INFO protocol _, inInfo := tmp[curl] // Remove from the temp map so that at the end we are left with only // new (or restarted) servers that need to be added to the pool. delete(tmp, curl) // Keep servers that were set through Options, but also the one that // we are currently connected to (even if it is a discovered server). if !srv.isImplicit || srv.url == nc.current.url { continue } if !inInfo { // Remove from server pool. Keep current order. copy(sp[i:], sp[i+1:]) nc.srvPool = sp[:len(sp)-1] sp = nc.srvPool i-- } } // Figure out if we should save off the current non-IP hostname if we encounter a bare IP. saveTLS := nc.current != nil && !hostIsIP(nc.current.url) // If there are any left in the tmp map, these are new (or restarted) servers // and need to be added to the pool. for curl := range tmp { // Before adding, check if this is a new (as in never seen) URL. // This is used to figure out if we invoke the DiscoveredServersCB if _, present := nc.urls[curl]; !present { hasNew = true } nc.addURLToPool(fmt.Sprintf("%s://%s", nc.connScheme(), curl), true, saveTLS) } if hasNew { // Randomize the pool if allowed but leave the first URL in place. if !nc.Opts.NoRandomize { nc.shufflePool(1) } if !nc.initc && nc.Opts.DiscoveredServersCB != nil { nc.ach.push(func() { nc.Opts.DiscoveredServersCB(nc) }) } } if !nc.initc && ncInfo.LameDuckMode && nc.Opts.LameDuckModeHandler != nil { nc.ach.push(func() { nc.Opts.LameDuckModeHandler(nc) }) } return nil } // processAsyncInfo does the same than processInfo, but is called // from the parser. Calls processInfo under connection's lock // protection. func (nc *Conn) processAsyncInfo(info []byte) { nc.mu.Lock() // Ignore errors, we will simply not update the server pool... nc.processInfo(string(info)) nc.mu.Unlock() } // LastError reports the last error encountered via the connection. // It can be used reliably within ClosedCB in order to find out reason // why connection was closed for example. func (nc *Conn) LastError() error { if nc == nil { return ErrInvalidConnection } nc.mu.RLock() err := nc.err nc.mu.RUnlock() return err } // Check if the given error string is an auth error, and if so returns // the corresponding ErrXXX error, nil otherwise func checkAuthError(e string) error { if strings.HasPrefix(e, AUTHORIZATION_ERR) { return ErrAuthorization } if strings.HasPrefix(e, AUTHENTICATION_EXPIRED_ERR) { return ErrAuthExpired } if strings.HasPrefix(e, AUTHENTICATION_REVOKED_ERR) { return ErrAuthRevoked } if strings.HasPrefix(e, ACCOUNT_AUTHENTICATION_EXPIRED_ERR) { return ErrAccountAuthExpired } return nil } // processErr processes any error messages from the server and // sets the connection's LastError. func (nc *Conn) processErr(ie string) { // Trim, remove quotes ne := normalizeErr(ie) // convert to lower case. e := strings.ToLower(ne) close := false // FIXME(dlc) - process Slow Consumer signals special. if e == STALE_CONNECTION { nc.processOpErr(ErrStaleConnection) } else if e == MAX_CONNECTIONS_ERR { nc.processOpErr(ErrMaxConnectionsExceeded) } else if strings.HasPrefix(e, PERMISSIONS_ERR) { nc.processPermissionsViolation(ne) } else if authErr := checkAuthError(e); authErr != nil { nc.mu.Lock() close = nc.processAuthError(authErr) nc.mu.Unlock() } else { close = true nc.mu.Lock() nc.err = errors.New("nats: " + ne) nc.mu.Unlock() } if close { nc.close(CLOSED, true, nil) } } // kickFlusher will send a bool on a channel to kick the // flush Go routine to flush data to the server. func (nc *Conn) kickFlusher() { if nc.bw != nil { select { case nc.fch <- struct{}{}: default: } } } // Publish publishes the data argument to the given subject. The data // argument is left untouched and needs to be correctly interpreted on // the receiver. func (nc *Conn) Publish(subj string, data []byte) error { return nc.publish(subj, _EMPTY_, nil, data) } // Header represents the optional Header for a NATS message, // based on the implementation of http.Header. type Header map[string][]string // Add adds the key, value pair to the header. It is case-sensitive // and appends to any existing values associated with key. func (h Header) Add(key, value string) { h[key] = append(h[key], value) } // Set sets the header entries associated with key to the single // element value. It is case-sensitive and replaces any existing // values associated with key. func (h Header) Set(key, value string) { h[key] = []string{value} } // Get gets the first value associated with the given key. // It is case-sensitive. func (h Header) Get(key string) string { if h == nil { return _EMPTY_ } if v := h[key]; v != nil { return v[0] } return _EMPTY_ } // Values returns all values associated with the given key. // It is case-sensitive. func (h Header) Values(key string) []string { return h[key] } // Del deletes the values associated with a key. // It is case-sensitive. func (h Header) Del(key string) { delete(h, key) } // NewMsg creates a message for publishing that will use headers. func NewMsg(subject string) *Msg { return &Msg{ Subject: subject, Header: make(Header), } } const ( hdrLine = "NATS/1.0\r\n" crlf = "\r\n" hdrPreEnd = len(hdrLine) - len(crlf) statusHdr = "Status" descrHdr = "Description" lastConsumerSeqHdr = "Nats-Last-Consumer" lastStreamSeqHdr = "Nats-Last-Stream" consumerStalledHdr = "Nats-Consumer-Stalled" noResponders = "503" noMessagesSts = "404" reqTimeoutSts = "408" jetStream409Sts = "409" controlMsg = "100" statusLen = 3 // e.g. 20x, 40x, 50x ) // DecodeHeadersMsg will decode and headers. func DecodeHeadersMsg(data []byte) (Header, error) { br := bufio.NewReaderSize(bytes.NewReader(data), 128) tp := textproto.NewReader(br) l, err := tp.ReadLine() if err != nil || len(l) < hdrPreEnd || l[:hdrPreEnd] != hdrLine[:hdrPreEnd] { return nil, ErrBadHeaderMsg } mh, err := readMIMEHeader(tp) if err != nil { return nil, err } // Check if we have an inlined status. if len(l) > hdrPreEnd { var description string status := strings.TrimSpace(l[hdrPreEnd:]) if len(status) != statusLen { description = strings.TrimSpace(status[statusLen:]) status = status[:statusLen] } mh.Add(statusHdr, status) if len(description) > 0 { mh.Add(descrHdr, description) } } return Header(mh), nil } // readMIMEHeader returns a MIMEHeader that preserves the // original case of the MIME header, based on the implementation // of textproto.ReadMIMEHeader. // // https://golang.org/pkg/net/textproto/#Reader.ReadMIMEHeader func readMIMEHeader(tp *textproto.Reader) (textproto.MIMEHeader, error) { m := make(textproto.MIMEHeader) for { kv, err := tp.ReadLine() if len(kv) == 0 { return m, err } // Process key fetching original case. i := bytes.IndexByte([]byte(kv), ':') if i < 0 { return nil, ErrBadHeaderMsg } key := kv[:i] if key == "" { // Skip empty keys. continue } i++ for i < len(kv) && (kv[i] == ' ' || kv[i] == '\t') { i++ } value := string(kv[i:]) m[key] = append(m[key], value) if err != nil { return m, err } } } // PublishMsg publishes the Msg structure, which includes the // Subject, an optional Reply and an optional Data field. func (nc *Conn) PublishMsg(m *Msg) error { if m == nil { return ErrInvalidMsg } hdr, err := m.headerBytes() if err != nil { return err } return nc.publish(m.Subject, m.Reply, hdr, m.Data) } // PublishRequest will perform a Publish() expecting a response on the // reply subject. Use Request() for automatically waiting for a response // inline. func (nc *Conn) PublishRequest(subj, reply string, data []byte) error { return nc.publish(subj, reply, nil, data) } // Used for handrolled Itoa const digits = "0123456789" // publish is the internal function to publish messages to a nats-server. // Sends a protocol data message by queuing into the bufio writer // and kicking the flush go routine. These writes should be protected. func (nc *Conn) publish(subj, reply string, hdr, data []byte) error { if nc == nil { return ErrInvalidConnection } if subj == "" { return ErrBadSubject } nc.mu.Lock() // Check if headers attempted to be sent to server that does not support them. if len(hdr) > 0 && !nc.info.Headers { nc.mu.Unlock() return ErrHeadersNotSupported } if nc.isClosed() { nc.mu.Unlock() return ErrConnectionClosed } if nc.isDrainingPubs() { nc.mu.Unlock() return ErrConnectionDraining } // Proactively reject payloads over the threshold set by server. msgSize := int64(len(data) + len(hdr)) // Skip this check if we are not yet connected (RetryOnFailedConnect) if !nc.initc && msgSize > nc.info.MaxPayload { nc.mu.Unlock() return ErrMaxPayload } // Check if we are reconnecting, and if so check if // we have exceeded our reconnect outbound buffer limits. if nc.bw.atLimitIfUsingPending() { nc.mu.Unlock() return ErrReconnectBufExceeded } var mh []byte if hdr != nil { mh = nc.scratch[:len(_HPUB_P_)] } else { mh = nc.scratch[1:len(_HPUB_P_)] } mh = append(mh, subj...) mh = append(mh, ' ') if reply != "" { mh = append(mh, reply...) mh = append(mh, ' ') } // We could be smarter here, but simple loop is ok, // just avoid strconv in fast path. // FIXME(dlc) - Find a better way here. // msgh = strconv.AppendInt(msgh, int64(len(data)), 10) // go 1.14 some values strconv faster, may be able to switch over. var b [12]byte var i = len(b) if hdr != nil { if len(hdr) > 0 { for l := len(hdr); l > 0; l /= 10 { i-- b[i] = digits[l%10] } } else { i-- b[i] = digits[0] } mh = append(mh, b[i:]...) mh = append(mh, ' ') // reset for below. i = len(b) } if msgSize > 0 { for l := msgSize; l > 0; l /= 10 { i-- b[i] = digits[l%10] } } else { i-- b[i] = digits[0] } mh = append(mh, b[i:]...) mh = append(mh, _CRLF_...) if err := nc.bw.appendBufs(mh, hdr, data, _CRLF_BYTES_); err != nil { nc.mu.Unlock() return err } nc.OutMsgs++ nc.OutBytes += uint64(len(data) + len(hdr)) if len(nc.fch) == 0 { nc.kickFlusher() } nc.mu.Unlock() return nil } // respHandler is the global response handler. It will look up // the appropriate channel based on the last token and place // the message on the channel if possible. func (nc *Conn) respHandler(m *Msg) { nc.mu.Lock() // Just return if closed. if nc.isClosed() { nc.mu.Unlock() return } var mch chan *Msg // Grab mch rt := nc.respToken(m.Subject) if rt != _EMPTY_ { mch = nc.respMap[rt] // Delete the key regardless, one response only. delete(nc.respMap, rt) } else if len(nc.respMap) == 1 { // If the server has rewritten the subject, the response token (rt) // will not match (could be the case with JetStream). If that is the // case and there is a single entry, use that. for k, v := range nc.respMap { mch = v delete(nc.respMap, k) break } } nc.mu.Unlock() // Don't block, let Request timeout instead, mch is // buffered and we should delete the key before a // second response is processed. select { case mch <- m: default: return } } // Helper to setup and send new request style requests. Return the chan to receive the response. func (nc *Conn) createNewRequestAndSend(subj string, hdr, data []byte) (chan *Msg, string, error) { nc.mu.Lock() // Do setup for the new style if needed. if nc.respMap == nil { nc.initNewResp() } // Create new literal Inbox and map to a chan msg. mch := make(chan *Msg, RequestChanLen) respInbox := nc.newRespInbox() token := respInbox[nc.respSubLen:] nc.respMap[token] = mch if nc.respMux == nil { // Create the response subscription we will use for all new style responses. // This will be on an _INBOX with an additional terminal token. The subscription // will be on a wildcard. s, err := nc.subscribeLocked(nc.respSub, _EMPTY_, nc.respHandler, nil, false, nil) if err != nil { nc.mu.Unlock() return nil, token, err } nc.respScanf = strings.Replace(nc.respSub, "*", "%s", -1) nc.respMux = s } nc.mu.Unlock() if err := nc.publish(subj, respInbox, hdr, data); err != nil { return nil, token, err } return mch, token, nil } // RequestMsg will send a request payload including optional headers and deliver // the response message, or an error, including a timeout if no message was received properly. func (nc *Conn) RequestMsg(msg *Msg, timeout time.Duration) (*Msg, error) { if msg == nil { return nil, ErrInvalidMsg } hdr, err := msg.headerBytes() if err != nil { return nil, err } return nc.request(msg.Subject, hdr, msg.Data, timeout) } // Request will send a request payload and deliver the response message, // or an error, including a timeout if no message was received properly. func (nc *Conn) Request(subj string, data []byte, timeout time.Duration) (*Msg, error) { return nc.request(subj, nil, data, timeout) } func (nc *Conn) useOldRequestStyle() bool { nc.mu.RLock() r := nc.Opts.UseOldRequestStyle nc.mu.RUnlock() return r } func (nc *Conn) request(subj string, hdr, data []byte, timeout time.Duration) (*Msg, error) { if nc == nil { return nil, ErrInvalidConnection } var m *Msg var err error if nc.useOldRequestStyle() { m, err = nc.oldRequest(subj, hdr, data, timeout) } else { m, err = nc.newRequest(subj, hdr, data, timeout) } // Check for no responder status. if err == nil && len(m.Data) == 0 && m.Header.Get(statusHdr) == noResponders { m, err = nil, ErrNoResponders } return m, err } func (nc *Conn) newRequest(subj string, hdr, data []byte, timeout time.Duration) (*Msg, error) { mch, token, err := nc.createNewRequestAndSend(subj, hdr, data) if err != nil { return nil, err } t := globalTimerPool.Get(timeout) defer globalTimerPool.Put(t) var ok bool var msg *Msg select { case msg, ok = <-mch: if !ok { return nil, ErrConnectionClosed } case <-t.C: nc.mu.Lock() delete(nc.respMap, token) nc.mu.Unlock() return nil, ErrTimeout } return msg, nil } // oldRequest will create an Inbox and perform a Request() call // with the Inbox reply and return the first reply received. // This is optimized for the case of multiple responses. func (nc *Conn) oldRequest(subj string, hdr, data []byte, timeout time.Duration) (*Msg, error) { inbox := nc.NewInbox() ch := make(chan *Msg, RequestChanLen) s, err := nc.subscribe(inbox, _EMPTY_, nil, ch, true, nil) if err != nil { return nil, err } s.AutoUnsubscribe(1) defer s.Unsubscribe() err = nc.publish(subj, inbox, hdr, data) if err != nil { return nil, err } return s.NextMsg(timeout) } // InboxPrefix is the prefix for all inbox subjects. const ( InboxPrefix = "_INBOX." inboxPrefixLen = len(InboxPrefix) replySuffixLen = 8 // Gives us 62^8 rdigits = "0123456789ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz" base = 62 ) // NewInbox will return an inbox string which can be used for directed replies from // subscribers. These are guaranteed to be unique, but can be shared and subscribed // to by others. func NewInbox() string { var b [inboxPrefixLen + nuidSize]byte pres := b[:inboxPrefixLen] copy(pres, InboxPrefix) ns := b[inboxPrefixLen:] copy(ns, nuid.Next()) return string(b[:]) } // Create a new inbox that is prefix aware. func (nc *Conn) NewInbox() string { if nc.Opts.InboxPrefix == _EMPTY_ { return NewInbox() } var sb strings.Builder sb.WriteString(nc.Opts.InboxPrefix) sb.WriteByte('.') sb.WriteString(nuid.Next()) return sb.String() } // Function to init new response structures. func (nc *Conn) initNewResp() { nc.respSubPrefix = fmt.Sprintf("%s.", nc.NewInbox()) nc.respSubLen = len(nc.respSubPrefix) nc.respSub = fmt.Sprintf("%s*", nc.respSubPrefix) nc.respMap = make(map[string]chan *Msg) nc.respRand = rand.New(rand.NewSource(time.Now().UnixNano())) } // newRespInbox creates a new literal response subject // that will trigger the mux subscription handler. // Lock should be held. func (nc *Conn) newRespInbox() string { if nc.respMap == nil { nc.initNewResp() } var sb strings.Builder sb.WriteString(nc.respSubPrefix) rn := nc.respRand.Int63() for i := 0; i < replySuffixLen; i++ { sb.WriteByte(rdigits[rn%base]) rn /= base } return sb.String() } // NewRespInbox is the new format used for _INBOX. func (nc *Conn) NewRespInbox() string { nc.mu.Lock() s := nc.newRespInbox() nc.mu.Unlock() return s } // respToken will return the last token of a literal response inbox // which we use for the message channel lookup. This needs to do a // scan to protect itself against the server changing the subject. // Lock should be held. func (nc *Conn) respToken(respInbox string) string { var token string n, err := fmt.Sscanf(respInbox, nc.respScanf, &token) if err != nil || n != 1 { return "" } return token } // Subscribe will express interest in the given subject. The subject // can have wildcards. // There are two type of wildcards: * for partial, and > for full. // A subscription on subject time.*.east would receive messages sent to time.us.east and time.eu.east. // A subscription on subject time.us.> would receive messages sent to // time.us.east and time.us.east.atlanta, while time.us.* would only match time.us.east // since it can't match more than one token. // Messages will be delivered to the associated MsgHandler. func (nc *Conn) Subscribe(subj string, cb MsgHandler) (*Subscription, error) { return nc.subscribe(subj, _EMPTY_, cb, nil, false, nil) } // ChanSubscribe will express interest in the given subject and place // all messages received on the channel. // You should not close the channel until sub.Unsubscribe() has been called. func (nc *Conn) ChanSubscribe(subj string, ch chan *Msg) (*Subscription, error) { return nc.subscribe(subj, _EMPTY_, nil, ch, false, nil) } // ChanQueueSubscribe will express interest in the given subject. // All subscribers with the same queue name will form the queue group // and only one member of the group will be selected to receive any given message, // which will be placed on the channel. // You should not close the channel until sub.Unsubscribe() has been called. // Note: This is the same than QueueSubscribeSyncWithChan. func (nc *Conn) ChanQueueSubscribe(subj, group string, ch chan *Msg) (*Subscription, error) { return nc.subscribe(subj, group, nil, ch, false, nil) } // SubscribeSync will express interest on the given subject. Messages will // be received synchronously using Subscription.NextMsg(). func (nc *Conn) SubscribeSync(subj string) (*Subscription, error) { if nc == nil { return nil, ErrInvalidConnection } mch := make(chan *Msg, nc.Opts.SubChanLen) return nc.subscribe(subj, _EMPTY_, nil, mch, true, nil) } // QueueSubscribe creates an asynchronous queue subscriber on the given subject. // All subscribers with the same queue name will form the queue group and // only one member of the group will be selected to receive any given // message asynchronously. func (nc *Conn) QueueSubscribe(subj, queue string, cb MsgHandler) (*Subscription, error) { return nc.subscribe(subj, queue, cb, nil, false, nil) } // QueueSubscribeSync creates a synchronous queue subscriber on the given // subject. All subscribers with the same queue name will form the queue // group and only one member of the group will be selected to receive any // given message synchronously using Subscription.NextMsg(). func (nc *Conn) QueueSubscribeSync(subj, queue string) (*Subscription, error) { mch := make(chan *Msg, nc.Opts.SubChanLen) return nc.subscribe(subj, queue, nil, mch, true, nil) } // QueueSubscribeSyncWithChan will express interest in the given subject. // All subscribers with the same queue name will form the queue group // and only one member of the group will be selected to receive any given message, // which will be placed on the channel. // You should not close the channel until sub.Unsubscribe() has been called. // Note: This is the same than ChanQueueSubscribe. func (nc *Conn) QueueSubscribeSyncWithChan(subj, queue string, ch chan *Msg) (*Subscription, error) { return nc.subscribe(subj, queue, nil, ch, false, nil) } // badSubject will do quick test on whether a subject is acceptable. // Spaces are not allowed and all tokens should be > 0 in len. func badSubject(subj string) bool { if strings.ContainsAny(subj, " \t\r\n") { return true } tokens := strings.Split(subj, ".") for _, t := range tokens { if len(t) == 0 { return true } } return false } // badQueue will check a queue name for whitespace. func badQueue(qname string) bool { return strings.ContainsAny(qname, " \t\r\n") } // subscribe is the internal subscribe function that indicates interest in a subject. func (nc *Conn) subscribe(subj, queue string, cb MsgHandler, ch chan *Msg, isSync bool, js *jsSub) (*Subscription, error) { if nc == nil { return nil, ErrInvalidConnection } nc.mu.Lock() defer nc.mu.Unlock() return nc.subscribeLocked(subj, queue, cb, ch, isSync, js) } func (nc *Conn) subscribeLocked(subj, queue string, cb MsgHandler, ch chan *Msg, isSync bool, js *jsSub) (*Subscription, error) { if nc == nil { return nil, ErrInvalidConnection } if badSubject(subj) { return nil, ErrBadSubject } if queue != _EMPTY_ && badQueue(queue) { return nil, ErrBadQueueName } // Check for some error conditions. if nc.isClosed() { return nil, ErrConnectionClosed } if nc.isDraining() { return nil, ErrConnectionDraining } if cb == nil && ch == nil { return nil, ErrBadSubscription } sub := &Subscription{ Subject: subj, Queue: queue, mcb: cb, conn: nc, jsi: js, } // Set pending limits. if ch != nil { sub.pMsgsLimit = cap(ch) } else { sub.pMsgsLimit = DefaultSubPendingMsgsLimit } sub.pBytesLimit = DefaultSubPendingBytesLimit // If we have an async callback, start up a sub specific // Go routine to deliver the messages. var sr bool if cb != nil { sub.typ = AsyncSubscription sub.pCond = sync.NewCond(&sub.mu) sr = true } else if !isSync { sub.typ = ChanSubscription sub.mch = ch } else { // Sync Subscription sub.typ = SyncSubscription sub.mch = ch } nc.subsMu.Lock() nc.ssid++ sub.sid = nc.ssid nc.subs[sub.sid] = sub nc.subsMu.Unlock() // Let's start the go routine now that it is fully setup and registered. if sr { go nc.waitForMsgs(sub) } // We will send these for all subs when we reconnect // so that we can suppress here if reconnecting. if !nc.isReconnecting() { nc.bw.appendString(fmt.Sprintf(subProto, subj, queue, sub.sid)) nc.kickFlusher() } return sub, nil } // NumSubscriptions returns active number of subscriptions. func (nc *Conn) NumSubscriptions() int { nc.mu.RLock() defer nc.mu.RUnlock() return len(nc.subs) } // Lock for nc should be held here upon entry func (nc *Conn) removeSub(s *Subscription) { nc.subsMu.Lock() delete(nc.subs, s.sid) nc.subsMu.Unlock() s.mu.Lock() defer s.mu.Unlock() // Release callers on NextMsg for SyncSubscription only if s.mch != nil && s.typ == SyncSubscription { close(s.mch) } s.mch = nil // If JS subscription then stop HB timer. if jsi := s.jsi; jsi != nil { if jsi.hbc != nil { jsi.hbc.Stop() jsi.hbc = nil } if jsi.csfct != nil { jsi.csfct.Stop() jsi.csfct = nil } } // Mark as invalid s.closed = true if s.pCond != nil { s.pCond.Broadcast() } } // SubscriptionType is the type of the Subscription. type SubscriptionType int // The different types of subscription types. const ( AsyncSubscription = SubscriptionType(iota) SyncSubscription ChanSubscription NilSubscription PullSubscription ) // Type returns the type of Subscription. func (s *Subscription) Type() SubscriptionType { if s == nil { return NilSubscription } s.mu.Lock() defer s.mu.Unlock() // Pull subscriptions are really a SyncSubscription and we want this // type to be set internally for all delivered messages management, etc.. // So check when to return PullSubscription to the user. if s.jsi != nil && s.jsi.pull { return PullSubscription } return s.typ } // IsValid returns a boolean indicating whether the subscription // is still active. This will return false if the subscription has // already been closed. func (s *Subscription) IsValid() bool { if s == nil { return false } s.mu.Lock() defer s.mu.Unlock() return s.conn != nil && !s.closed } // Drain will remove interest but continue callbacks until all messages // have been processed. // // For a JetStream subscription, if the library has created the JetStream // consumer, the library will send a DeleteConsumer request to the server // when the Drain operation completes. If a failure occurs when deleting // the JetStream consumer, an error will be reported to the asynchronous // error callback. // If you do not wish the JetStream consumer to be automatically deleted, // ensure that the consumer is not created by the library, which means // create the consumer with AddConsumer and bind to this consumer. func (s *Subscription) Drain() error { if s == nil { return ErrBadSubscription } s.mu.Lock() conn := s.conn s.mu.Unlock() if conn == nil { return ErrBadSubscription } return conn.unsubscribe(s, 0, true) } // Unsubscribe will remove interest in the given subject. // // For a JetStream subscription, if the library has created the JetStream // consumer, it will send a DeleteConsumer request to the server (if the // unsubscribe itself was successful). If the delete operation fails, the // error will be returned. // If you do not wish the JetStream consumer to be automatically deleted, // ensure that the consumer is not created by the library, which means // create the consumer with AddConsumer and bind to this consumer (using // the nats.Bind() option). func (s *Subscription) Unsubscribe() error { if s == nil { return ErrBadSubscription } s.mu.Lock() conn := s.conn closed := s.closed dc := s.jsi != nil && s.jsi.dc s.mu.Unlock() if conn == nil || conn.IsClosed() { return ErrConnectionClosed } if closed { return ErrBadSubscription } if conn.IsDraining() { return ErrConnectionDraining } err := conn.unsubscribe(s, 0, false) if err == nil && dc { err = s.deleteConsumer() } return err } // checkDrained will watch for a subscription to be fully drained // and then remove it. func (nc *Conn) checkDrained(sub *Subscription) { if nc == nil || sub == nil { return } // This allows us to know that whatever we have in the client pending // is correct and the server will not send additional information. nc.Flush() sub.mu.Lock() // For JS subscriptions, check if we are going to delete the // JS consumer when drain completes. dc := sub.jsi != nil && sub.jsi.dc sub.mu.Unlock() // Once we are here we just wait for Pending to reach 0 or // any other state to exit this go routine. for { // check connection is still valid. if nc.IsClosed() { return } // Check subscription state sub.mu.Lock() conn := sub.conn closed := sub.closed pMsgs := sub.pMsgs sub.mu.Unlock() if conn == nil || closed || pMsgs == 0 { nc.mu.Lock() nc.removeSub(sub) nc.mu.Unlock() if dc { if err := sub.deleteConsumer(); err != nil { nc.mu.Lock() if errCB := nc.Opts.AsyncErrorCB; errCB != nil { nc.ach.push(func() { errCB(nc, sub, err) }) } nc.mu.Unlock() } } return } time.Sleep(100 * time.Millisecond) } } // AutoUnsubscribe will issue an automatic Unsubscribe that is // processed by the server when max messages have been received. // This can be useful when sending a request to an unknown number // of subscribers. func (s *Subscription) AutoUnsubscribe(max int) error { if s == nil { return ErrBadSubscription } s.mu.Lock() conn := s.conn closed := s.closed s.mu.Unlock() if conn == nil || closed { return ErrBadSubscription } return conn.unsubscribe(s, max, false) } // unsubscribe performs the low level unsubscribe to the server. // Use Subscription.Unsubscribe() func (nc *Conn) unsubscribe(sub *Subscription, max int, drainMode bool) error { var maxStr string if max > 0 { sub.mu.Lock() sub.max = uint64(max) if sub.delivered < sub.max { maxStr = strconv.Itoa(max) } sub.mu.Unlock() } nc.mu.Lock() // ok here, but defer is expensive defer nc.mu.Unlock() if nc.isClosed() { return ErrConnectionClosed } nc.subsMu.RLock() s := nc.subs[sub.sid] nc.subsMu.RUnlock() // Already unsubscribed if s == nil { return nil } if maxStr == _EMPTY_ && !drainMode { nc.removeSub(s) } if drainMode { go nc.checkDrained(sub) } // We will send these for all subs when we reconnect // so that we can suppress here. if !nc.isReconnecting() { nc.bw.appendString(fmt.Sprintf(unsubProto, s.sid, maxStr)) nc.kickFlusher() } // For JetStream subscriptions cancel the attached context if there is any. var cancel func() sub.mu.Lock() jsi := sub.jsi if jsi != nil { cancel = jsi.cancel jsi.cancel = nil } sub.mu.Unlock() if cancel != nil { cancel() } return nil } // NextMsg will return the next message available to a synchronous subscriber // or block until one is available. An error is returned if the subscription is invalid (ErrBadSubscription), // the connection is closed (ErrConnectionClosed), the timeout is reached (ErrTimeout), // or if there were no responders (ErrNoResponders) when used in the context of a request/reply. func (s *Subscription) NextMsg(timeout time.Duration) (*Msg, error) { if s == nil { return nil, ErrBadSubscription } s.mu.Lock() err := s.validateNextMsgState(false) if err != nil { s.mu.Unlock() return nil, err } // snapshot mch := s.mch s.mu.Unlock() var ok bool var msg *Msg // If something is available right away, let's optimize that case. select { case msg, ok = <-mch: if !ok { return nil, s.getNextMsgErr() } if err := s.processNextMsgDelivered(msg); err != nil { return nil, err } else { return msg, nil } default: } // If we are here a message was not immediately available, so lets loop // with a timeout. t := globalTimerPool.Get(timeout) defer globalTimerPool.Put(t) select { case msg, ok = <-mch: if !ok { return nil, s.getNextMsgErr() } if err := s.processNextMsgDelivered(msg); err != nil { return nil, err } case <-t.C: return nil, ErrTimeout } return msg, nil } // validateNextMsgState checks whether the subscription is in a valid // state to call NextMsg and be delivered another message synchronously. // This should be called while holding the lock. func (s *Subscription) validateNextMsgState(pullSubInternal bool) error { if s.connClosed { return ErrConnectionClosed } if s.mch == nil { if s.max > 0 && s.delivered >= s.max { return ErrMaxMessages } else if s.closed { return ErrBadSubscription } } if s.mcb != nil { return ErrSyncSubRequired } if s.sc { s.sc = false return ErrSlowConsumer } // Unless this is from an internal call, reject use of this API. // Users should use Fetch() instead. if !pullSubInternal && s.jsi != nil && s.jsi.pull { return ErrTypeSubscription } return nil } // This is called when the sync channel has been closed. // The error returned will be either connection or subscription // closed depending on what caused NextMsg() to fail. func (s *Subscription) getNextMsgErr() error { s.mu.Lock() defer s.mu.Unlock() if s.connClosed { return ErrConnectionClosed } return ErrBadSubscription } // processNextMsgDelivered takes a message and applies the needed // accounting to the stats from the subscription, returning an // error in case we have the maximum number of messages have been // delivered already. It should not be called while holding the lock. func (s *Subscription) processNextMsgDelivered(msg *Msg) error { s.mu.Lock() nc := s.conn max := s.max var fcReply string // Update some stats. s.delivered++ delivered := s.delivered if s.jsi != nil { fcReply = s.checkForFlowControlResponse() } if s.typ == SyncSubscription { s.pMsgs-- s.pBytes -= len(msg.Data) } s.mu.Unlock() if fcReply != _EMPTY_ { nc.Publish(fcReply, nil) } if max > 0 { if delivered > max { return ErrMaxMessages } // Remove subscription if we have reached max. if delivered == max { nc.mu.Lock() nc.removeSub(s) nc.mu.Unlock() } } if len(msg.Data) == 0 && msg.Header.Get(statusHdr) == noResponders { return ErrNoResponders } return nil } // Queued returns the number of queued messages in the client for this subscription. // DEPRECATED: Use Pending() func (s *Subscription) QueuedMsgs() (int, error) { m, _, err := s.Pending() return int(m), err } // Pending returns the number of queued messages and queued bytes in the client for this subscription. func (s *Subscription) Pending() (int, int, error) { if s == nil { return -1, -1, ErrBadSubscription } s.mu.Lock() defer s.mu.Unlock() if s.conn == nil || s.closed { return -1, -1, ErrBadSubscription } if s.typ == ChanSubscription { return -1, -1, ErrTypeSubscription } return s.pMsgs, s.pBytes, nil } // MaxPending returns the maximum number of queued messages and queued bytes seen so far. func (s *Subscription) MaxPending() (int, int, error) { if s == nil { return -1, -1, ErrBadSubscription } s.mu.Lock() defer s.mu.Unlock() if s.conn == nil || s.closed { return -1, -1, ErrBadSubscription } if s.typ == ChanSubscription { return -1, -1, ErrTypeSubscription } return s.pMsgsMax, s.pBytesMax, nil } // ClearMaxPending resets the maximums seen so far. func (s *Subscription) ClearMaxPending() error { if s == nil { return ErrBadSubscription } s.mu.Lock() defer s.mu.Unlock() if s.conn == nil || s.closed { return ErrBadSubscription } if s.typ == ChanSubscription { return ErrTypeSubscription } s.pMsgsMax, s.pBytesMax = 0, 0 return nil } // Pending Limits const ( // DefaultSubPendingMsgsLimit will be 512k msgs. DefaultSubPendingMsgsLimit = 512 * 1024 // DefaultSubPendingBytesLimit is 64MB DefaultSubPendingBytesLimit = 64 * 1024 * 1024 ) // PendingLimits returns the current limits for this subscription. // If no error is returned, a negative value indicates that the // given metric is not limited. func (s *Subscription) PendingLimits() (int, int, error) { if s == nil { return -1, -1, ErrBadSubscription } s.mu.Lock() defer s.mu.Unlock() if s.conn == nil || s.closed { return -1, -1, ErrBadSubscription } if s.typ == ChanSubscription { return -1, -1, ErrTypeSubscription } return s.pMsgsLimit, s.pBytesLimit, nil } // SetPendingLimits sets the limits for pending msgs and bytes for this subscription. // Zero is not allowed. Any negative value means that the given metric is not limited. func (s *Subscription) SetPendingLimits(msgLimit, bytesLimit int) error { if s == nil { return ErrBadSubscription } s.mu.Lock() defer s.mu.Unlock() if s.conn == nil || s.closed { return ErrBadSubscription } if s.typ == ChanSubscription { return ErrTypeSubscription } if msgLimit == 0 || bytesLimit == 0 { return ErrInvalidArg } s.pMsgsLimit, s.pBytesLimit = msgLimit, bytesLimit return nil } // Delivered returns the number of delivered messages for this subscription. func (s *Subscription) Delivered() (int64, error) { if s == nil { return -1, ErrBadSubscription } s.mu.Lock() defer s.mu.Unlock() if s.conn == nil || s.closed { return -1, ErrBadSubscription } return int64(s.delivered), nil } // Dropped returns the number of known dropped messages for this subscription. // This will correspond to messages dropped by violations of PendingLimits. If // the server declares the connection a SlowConsumer, this number may not be // valid. func (s *Subscription) Dropped() (int, error) { if s == nil { return -1, ErrBadSubscription } s.mu.Lock() defer s.mu.Unlock() if s.conn == nil || s.closed { return -1, ErrBadSubscription } return s.dropped, nil } // Respond allows a convenient way to respond to requests in service based subscriptions. func (m *Msg) Respond(data []byte) error { if m == nil || m.Sub == nil { return ErrMsgNotBound } if m.Reply == "" { return ErrMsgNoReply } m.Sub.mu.Lock() nc := m.Sub.conn m.Sub.mu.Unlock() // No need to check the connection here since the call to publish will do all the checking. return nc.Publish(m.Reply, data) } // RespondMsg allows a convenient way to respond to requests in service based subscriptions that might include headers func (m *Msg) RespondMsg(msg *Msg) error { if m == nil || m.Sub == nil { return ErrMsgNotBound } if m.Reply == "" { return ErrMsgNoReply } msg.Subject = m.Reply m.Sub.mu.Lock() nc := m.Sub.conn m.Sub.mu.Unlock() // No need to check the connection here since the call to publish will do all the checking. return nc.PublishMsg(msg) } // FIXME: This is a hack // removeFlushEntry is needed when we need to discard queued up responses // for our pings as part of a flush call. This happens when we have a flush // call outstanding and we call close. func (nc *Conn) removeFlushEntry(ch chan struct{}) bool { nc.mu.Lock() defer nc.mu.Unlock() if nc.pongs == nil { return false } for i, c := range nc.pongs { if c == ch { nc.pongs[i] = nil return true } } return false } // The lock must be held entering this function. func (nc *Conn) sendPing(ch chan struct{}) { nc.pongs = append(nc.pongs, ch) nc.bw.appendString(pingProto) // Flush in place. nc.bw.flush() } // This will fire periodically and send a client origin // ping to the server. Will also check that we have received // responses from the server. func (nc *Conn) processPingTimer() { nc.mu.Lock() if nc.status != CONNECTED { nc.mu.Unlock() return } // Check for violation nc.pout++ if nc.pout > nc.Opts.MaxPingsOut { nc.mu.Unlock() nc.processOpErr(ErrStaleConnection) return } nc.sendPing(nil) nc.ptmr.Reset(nc.Opts.PingInterval) nc.mu.Unlock() } // FlushTimeout allows a Flush operation to have an associated timeout. func (nc *Conn) FlushTimeout(timeout time.Duration) (err error) { if nc == nil { return ErrInvalidConnection } if timeout <= 0 { return ErrBadTimeout } nc.mu.Lock() if nc.isClosed() { nc.mu.Unlock() return ErrConnectionClosed } t := globalTimerPool.Get(timeout) defer globalTimerPool.Put(t) // Create a buffered channel to prevent chan send to block // in processPong() if this code here times out just when // PONG was received. ch := make(chan struct{}, 1) nc.sendPing(ch) nc.mu.Unlock() select { case _, ok := <-ch: if !ok { err = ErrConnectionClosed } else { close(ch) } case <-t.C: err = ErrTimeout } if err != nil { nc.removeFlushEntry(ch) } return } // RTT calculates the round trip time between this client and the server. func (nc *Conn) RTT() (time.Duration, error) { if nc.IsClosed() { return 0, ErrConnectionClosed } if nc.IsReconnecting() { return 0, ErrDisconnected } start := time.Now() if err := nc.FlushTimeout(10 * time.Second); err != nil { return 0, err } return time.Since(start), nil } // Flush will perform a round trip to the server and return when it // receives the internal reply. func (nc *Conn) Flush() error { return nc.FlushTimeout(10 * time.Second) } // Buffered will return the number of bytes buffered to be sent to the server. // FIXME(dlc) take into account disconnected state. func (nc *Conn) Buffered() (int, error) { nc.mu.RLock() defer nc.mu.RUnlock() if nc.isClosed() || nc.bw == nil { return -1, ErrConnectionClosed } return nc.bw.buffered(), nil } // resendSubscriptions will send our subscription state back to the // server. Used in reconnects func (nc *Conn) resendSubscriptions() { // Since we are going to send protocols to the server, we don't want to // be holding the subsMu lock (which is used in processMsg). So copy // the subscriptions in a temporary array. nc.subsMu.RLock() subs := make([]*Subscription, 0, len(nc.subs)) for _, s := range nc.subs { subs = append(subs, s) } nc.subsMu.RUnlock() for _, s := range subs { adjustedMax := uint64(0) s.mu.Lock() if s.max > 0 { if s.delivered < s.max { adjustedMax = s.max - s.delivered } // adjustedMax could be 0 here if the number of delivered msgs // reached the max, if so unsubscribe. if adjustedMax == 0 { s.mu.Unlock() nc.bw.writeDirect(fmt.Sprintf(unsubProto, s.sid, _EMPTY_)) continue } } subj, queue, sid := s.Subject, s.Queue, s.sid s.mu.Unlock() nc.bw.writeDirect(fmt.Sprintf(subProto, subj, queue, sid)) if adjustedMax > 0 { maxStr := strconv.Itoa(int(adjustedMax)) nc.bw.writeDirect(fmt.Sprintf(unsubProto, sid, maxStr)) } } } // This will clear any pending flush calls and release pending calls. // Lock is assumed to be held by the caller. func (nc *Conn) clearPendingFlushCalls() { // Clear any queued pongs, e.g. pending flush calls. for _, ch := range nc.pongs { if ch != nil { close(ch) } } nc.pongs = nil } // This will clear any pending Request calls. // Lock is assumed to be held by the caller. func (nc *Conn) clearPendingRequestCalls() { if nc.respMap == nil { return } for key, ch := range nc.respMap { if ch != nil { close(ch) delete(nc.respMap, key) } } } // Low level close call that will do correct cleanup and set // desired status. Also controls whether user defined callbacks // will be triggered. The lock should not be held entering this // function. This function will handle the locking manually. func (nc *Conn) close(status Status, doCBs bool, err error) { nc.mu.Lock() if nc.isClosed() { nc.status = status nc.mu.Unlock() return } nc.status = CLOSED // Kick the Go routines so they fall out. nc.kickFlusher() // If the reconnect timer is waiting between a reconnect attempt, // this will kick it out. if nc.rqch != nil { close(nc.rqch) nc.rqch = nil } // Clear any queued pongs, e.g. pending flush calls. nc.clearPendingFlushCalls() // Clear any queued and blocking Requests. nc.clearPendingRequestCalls() // Stop ping timer if set. nc.stopPingTimer() nc.ptmr = nil // Need to close and set TCP conn to nil if reconnect loop has stopped, // otherwise we would incorrectly invoke Disconnect handler (if set) // down below. if nc.ar && nc.conn != nil { nc.conn.Close() nc.conn = nil } else if nc.conn != nil { // Go ahead and make sure we have flushed the outbound nc.bw.flush() defer nc.conn.Close() } // Close sync subscriber channels and release any // pending NextMsg() calls. nc.subsMu.Lock() for _, s := range nc.subs { s.mu.Lock() // Release callers on NextMsg for SyncSubscription only if s.mch != nil && s.typ == SyncSubscription { close(s.mch) } s.mch = nil // Mark as invalid, for signaling to waitForMsgs s.closed = true // Mark connection closed in subscription s.connClosed = true // If we have an async subscription, signals it to exit if s.typ == AsyncSubscription && s.pCond != nil { s.pCond.Signal() } s.mu.Unlock() } nc.subs = nil nc.subsMu.Unlock() nc.changeConnStatus(status) // Perform appropriate callback if needed for a disconnect. if doCBs { if nc.conn != nil { if disconnectedErrCB := nc.Opts.DisconnectedErrCB; disconnectedErrCB != nil { nc.ach.push(func() { disconnectedErrCB(nc, err) }) } else if disconnectedCB := nc.Opts.DisconnectedCB; disconnectedCB != nil { nc.ach.push(func() { disconnectedCB(nc) }) } } if nc.Opts.ClosedCB != nil { nc.ach.push(func() { nc.Opts.ClosedCB(nc) }) } } // If this is terminal, then we have to notify the asyncCB handler that // it can exit once all async callbacks have been dispatched. if status == CLOSED { nc.ach.close() } nc.mu.Unlock() } // Close will close the connection to the server. This call will release // all blocking calls, such as Flush() and NextMsg() func (nc *Conn) Close() { if nc != nil { // This will be a no-op if the connection was not websocket. // We do this here as opposed to inside close() because we want // to do this only for the final user-driven close of the client. // Otherwise, we would need to change close() to pass a boolean // indicating that this is the case. nc.wsClose() nc.close(CLOSED, !nc.Opts.NoCallbacksAfterClientClose, nil) } } // IsClosed tests if a Conn has been closed. func (nc *Conn) IsClosed() bool { nc.mu.RLock() defer nc.mu.RUnlock() return nc.isClosed() } // IsReconnecting tests if a Conn is reconnecting. func (nc *Conn) IsReconnecting() bool { nc.mu.RLock() defer nc.mu.RUnlock() return nc.isReconnecting() } // IsConnected tests if a Conn is connected. func (nc *Conn) IsConnected() bool { nc.mu.RLock() defer nc.mu.RUnlock() return nc.isConnected() } // drainConnection will run in a separate Go routine and will // flush all publishes and drain all active subscriptions. func (nc *Conn) drainConnection() { // Snapshot subs list. nc.mu.Lock() // Check again here if we are in a state to not process. if nc.isClosed() { nc.mu.Unlock() return } if nc.isConnecting() || nc.isReconnecting() { nc.mu.Unlock() // Move to closed state. nc.Close() return } subs := make([]*Subscription, 0, len(nc.subs)) for _, s := range nc.subs { if s == nc.respMux { // Skip since might be in use while messages // are being processed (can miss responses). continue } subs = append(subs, s) } errCB := nc.Opts.AsyncErrorCB drainWait := nc.Opts.DrainTimeout respMux := nc.respMux nc.mu.Unlock() // for pushing errors with context. pushErr := func(err error) { nc.mu.Lock() nc.err = err if errCB != nil { nc.ach.push(func() { errCB(nc, nil, err) }) } nc.mu.Unlock() } // Do subs first, skip request handler if present. for _, s := range subs { if err := s.Drain(); err != nil { // We will notify about these but continue. pushErr(err) } } // Wait for the subscriptions to drop to zero. timeout := time.Now().Add(drainWait) var min int if respMux != nil { min = 1 } else { min = 0 } for time.Now().Before(timeout) { if nc.NumSubscriptions() == min { break } time.Sleep(10 * time.Millisecond) } // In case there was a request/response handler // then need to call drain at the end. if respMux != nil { if err := respMux.Drain(); err != nil { // We will notify about these but continue. pushErr(err) } for time.Now().Before(timeout) { if nc.NumSubscriptions() == 0 { break } time.Sleep(10 * time.Millisecond) } } // Check if we timed out. if nc.NumSubscriptions() != 0 { pushErr(ErrDrainTimeout) } // Flip State nc.mu.Lock() nc.changeConnStatus(DRAINING_PUBS) nc.mu.Unlock() // Do publish drain via Flush() call. err := nc.FlushTimeout(5 * time.Second) if err != nil { pushErr(err) } // Move to closed state. nc.Close() } // Drain will put a connection into a drain state. All subscriptions will // immediately be put into a drain state. Upon completion, the publishers // will be drained and can not publish any additional messages. Upon draining // of the publishers, the connection will be closed. Use the ClosedCB() // option to know when the connection has moved from draining to closed. // // See note in Subscription.Drain for JetStream subscriptions. func (nc *Conn) Drain() error { nc.mu.Lock() if nc.isClosed() { nc.mu.Unlock() return ErrConnectionClosed } if nc.isConnecting() || nc.isReconnecting() { nc.mu.Unlock() nc.Close() return ErrConnectionReconnecting } if nc.isDraining() { nc.mu.Unlock() return nil } nc.changeConnStatus(DRAINING_SUBS) go nc.drainConnection() nc.mu.Unlock() return nil } // IsDraining tests if a Conn is in the draining state. func (nc *Conn) IsDraining() bool { nc.mu.RLock() defer nc.mu.RUnlock() return nc.isDraining() } // caller must lock func (nc *Conn) getServers(implicitOnly bool) []string { poolSize := len(nc.srvPool) var servers = make([]string, 0) for i := 0; i < poolSize; i++ { if implicitOnly && !nc.srvPool[i].isImplicit { continue } url := nc.srvPool[i].url servers = append(servers, fmt.Sprintf("%s://%s", url.Scheme, url.Host)) } return servers } // Servers returns the list of known server urls, including additional // servers discovered after a connection has been established. If // authentication is enabled, use UserInfo or Token when connecting with // these urls. func (nc *Conn) Servers() []string { nc.mu.RLock() defer nc.mu.RUnlock() return nc.getServers(false) } // DiscoveredServers returns only the server urls that have been discovered // after a connection has been established. If authentication is enabled, // use UserInfo or Token when connecting with these urls. func (nc *Conn) DiscoveredServers() []string { nc.mu.RLock() defer nc.mu.RUnlock() return nc.getServers(true) } // Status returns the current state of the connection. func (nc *Conn) Status() Status { nc.mu.RLock() defer nc.mu.RUnlock() return nc.status } // Test if Conn has been closed Lock is assumed held. func (nc *Conn) isClosed() bool { return nc.status == CLOSED } // Test if Conn is in the process of connecting func (nc *Conn) isConnecting() bool { return nc.status == CONNECTING } // Test if Conn is being reconnected. func (nc *Conn) isReconnecting() bool { return nc.status == RECONNECTING } // Test if Conn is connected or connecting. func (nc *Conn) isConnected() bool { return nc.status == CONNECTED || nc.isDraining() } // Test if Conn is in the draining state. func (nc *Conn) isDraining() bool { return nc.status == DRAINING_SUBS || nc.status == DRAINING_PUBS } // Test if Conn is in the draining state for pubs. func (nc *Conn) isDrainingPubs() bool { return nc.status == DRAINING_PUBS } // Stats will return a race safe copy of the Statistics section for the connection. func (nc *Conn) Stats() Statistics { // Stats are updated either under connection's mu or with atomic operations // for inbound stats in processMsg(). nc.mu.Lock() stats := Statistics{ InMsgs: atomic.LoadUint64(&nc.InMsgs), InBytes: atomic.LoadUint64(&nc.InBytes), OutMsgs: nc.OutMsgs, OutBytes: nc.OutBytes, Reconnects: nc.Reconnects, } nc.mu.Unlock() return stats } // MaxPayload returns the size limit that a message payload can have. // This is set by the server configuration and delivered to the client // upon connect. func (nc *Conn) MaxPayload() int64 { nc.mu.RLock() defer nc.mu.RUnlock() return nc.info.MaxPayload } // HeadersSupported will return if the server supports headers func (nc *Conn) HeadersSupported() bool { nc.mu.RLock() defer nc.mu.RUnlock() return nc.info.Headers } // AuthRequired will return if the connected server requires authorization. func (nc *Conn) AuthRequired() bool { nc.mu.RLock() defer nc.mu.RUnlock() return nc.info.AuthRequired } // TLSRequired will return if the connected server requires TLS connections. func (nc *Conn) TLSRequired() bool { nc.mu.RLock() defer nc.mu.RUnlock() return nc.info.TLSRequired } // Barrier schedules the given function `f` to all registered asynchronous // subscriptions. // Only the last subscription to see this barrier will invoke the function. // If no subscription is registered at the time of this call, `f()` is invoked // right away. // ErrConnectionClosed is returned if the connection is closed prior to // the call. func (nc *Conn) Barrier(f func()) error { nc.mu.Lock() if nc.isClosed() { nc.mu.Unlock() return ErrConnectionClosed } nc.subsMu.Lock() // Need to figure out how many non chan subscriptions there are numSubs := 0 for _, sub := range nc.subs { if sub.typ == AsyncSubscription { numSubs++ } } if numSubs == 0 { nc.subsMu.Unlock() nc.mu.Unlock() f() return nil } barrier := &barrierInfo{refs: int64(numSubs), f: f} for _, sub := range nc.subs { sub.mu.Lock() if sub.mch == nil { msg := &Msg{barrier: barrier} // Push onto the async pList if sub.pTail != nil { sub.pTail.next = msg } else { sub.pHead = msg sub.pCond.Signal() } sub.pTail = msg } sub.mu.Unlock() } nc.subsMu.Unlock() nc.mu.Unlock() return nil } // GetClientIP returns the client IP as known by the server. // Supported as of server version 2.1.6. func (nc *Conn) GetClientIP() (net.IP, error) { nc.mu.RLock() defer nc.mu.RUnlock() if nc.isClosed() { return nil, ErrConnectionClosed } if nc.info.ClientIP == "" { return nil, ErrClientIPNotSupported } ip := net.ParseIP(nc.info.ClientIP) return ip, nil } // GetClientID returns the client ID assigned by the server to which // the client is currently connected to. Note that the value may change if // the client reconnects. // This function returns ErrClientIDNotSupported if the server is of a // version prior to 1.2.0. func (nc *Conn) GetClientID() (uint64, error) { nc.mu.RLock() defer nc.mu.RUnlock() if nc.isClosed() { return 0, ErrConnectionClosed } if nc.info.CID == 0 { return 0, ErrClientIDNotSupported } return nc.info.CID, nil } // StatusChanged returns a channel on which given list of connection status changes will be reported. // If no statuses are provided, defaults will be used: CONNECTED, RECONNECTING, DISCONNECTED, CLOSED. func (nc *Conn) StatusChanged(statuses ...Status) chan Status { if len(statuses) == 0 { statuses = []Status{CONNECTED, RECONNECTING, DISCONNECTED, CLOSED} } ch := make(chan Status, 10) for _, s := range statuses { nc.registerStatusChangeListener(s, ch) } return ch } // registerStatusChangeListener registers a channel waiting for a specific status change event. // Status change events are non-blocking - if no receiver is waiting for the status change, // it will not be sent on the channel. Closed channels are ignored. func (nc *Conn) registerStatusChangeListener(status Status, ch chan Status) { nc.mu.Lock() defer nc.mu.Unlock() if nc.statListeners == nil { nc.statListeners = make(map[Status][]chan Status) } if _, ok := nc.statListeners[status]; !ok { nc.statListeners[status] = make([]chan Status, 0) } nc.statListeners[status] = append(nc.statListeners[status], ch) } // sendStatusEvent sends connection status event to all channels. // If channel is closed, or there is no listener, sendStatusEvent // will not block. Lock should be held entering. func (nc *Conn) sendStatusEvent(s Status) { Loop: for i := 0; i < len(nc.statListeners[s]); i++ { // make sure channel is not closed select { case <-nc.statListeners[s][i]: // if chan is closed, remove it nc.statListeners[s][i] = nc.statListeners[s][len(nc.statListeners[s])-1] nc.statListeners[s] = nc.statListeners[s][:len(nc.statListeners[s])-1] i-- continue Loop default: } // only send event if someone's listening select { case nc.statListeners[s][i] <- s: default: } } } // changeConnStatus changes connections status and sends events // to all listeners. Lock should be held entering. func (nc *Conn) changeConnStatus(status Status) { if nc == nil { return } nc.sendStatusEvent(status) nc.status = status } // NkeyOptionFromSeed will load an nkey pair from a seed file. // It will return the NKey Option and will handle // signing of nonce challenges from the server. It will take // care to not hold keys in memory and to wipe memory. func NkeyOptionFromSeed(seedFile string) (Option, error) { kp, err := nkeyPairFromSeedFile(seedFile) if err != nil { return nil, err } // Wipe our key on exit. defer kp.Wipe() pub, err := kp.PublicKey() if err != nil { return nil, err } if !nkeys.IsValidPublicUserKey(pub) { return nil, fmt.Errorf("nats: Not a valid nkey user seed") } sigCB := func(nonce []byte) ([]byte, error) { return sigHandler(nonce, seedFile) } return Nkey(string(pub), sigCB), nil } // Just wipe slice with 'x', for clearing contents of creds or nkey seed file. func wipeSlice(buf []byte) { for i := range buf { buf[i] = 'x' } } func userFromFile(userFile string) (string, error) { path, err := expandPath(userFile) if err != nil { return _EMPTY_, fmt.Errorf("nats: %w", err) } contents, err := os.ReadFile(path) if err != nil { return _EMPTY_, fmt.Errorf("nats: %w", err) } defer wipeSlice(contents) return nkeys.ParseDecoratedJWT(contents) } func homeDir() (string, error) { if runtime.GOOS == "windows" { homeDrive, homePath := os.Getenv("HOMEDRIVE"), os.Getenv("HOMEPATH") userProfile := os.Getenv("USERPROFILE") var home string if homeDrive == "" || homePath == "" { if userProfile == "" { return _EMPTY_, errors.New("nats: failed to get home dir, require %HOMEDRIVE% and %HOMEPATH% or %USERPROFILE%") } home = userProfile } else { home = filepath.Join(homeDrive, homePath) } return home, nil } home := os.Getenv("HOME") if home == "" { return _EMPTY_, errors.New("nats: failed to get home dir, require $HOME") } return home, nil } func expandPath(p string) (string, error) { p = os.ExpandEnv(p) if !strings.HasPrefix(p, "~") { return p, nil } home, err := homeDir() if err != nil { return _EMPTY_, err } return filepath.Join(home, p[1:]), nil } func nkeyPairFromSeedFile(seedFile string) (nkeys.KeyPair, error) { contents, err := os.ReadFile(seedFile) if err != nil { return nil, fmt.Errorf("nats: %w", err) } defer wipeSlice(contents) return nkeys.ParseDecoratedNKey(contents) } // Sign authentication challenges from the server. // Do not keep private seed in memory. func sigHandler(nonce []byte, seedFile string) ([]byte, error) { kp, err := nkeyPairFromSeedFile(seedFile) if err != nil { return nil, fmt.Errorf("unable to extract key pair from file %q: %w", seedFile, err) } // Wipe our key on exit. defer kp.Wipe() sig, _ := kp.Sign(nonce) return sig, nil } type timeoutWriter struct { timeout time.Duration conn net.Conn err error } // Write implements the io.Writer interface. func (tw *timeoutWriter) Write(p []byte) (int, error) { if tw.err != nil { return 0, tw.err } var n int tw.conn.SetWriteDeadline(time.Now().Add(tw.timeout)) n, tw.err = tw.conn.Write(p) tw.conn.SetWriteDeadline(time.Time{}) return n, tw.err }